4-(4-chlorophenoxy)benzoic acid
4-(4-chlorophenoxy)benzoic acid structure
|
Common Name | 4-(4-chlorophenoxy)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 21120-67-2 | Molecular Weight | 248.66200 | |
| Density | 1.347g/cm3 | Boiling Point | 392.3ºC at 760mmHg | |
| Molecular Formula | C13H9ClO3 | Melting Point | 167-171ºC | |
| MSDS | Chinese USA | Flash Point | 191.1ºC | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(4-chlorophenoxy)benzoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.347g/cm3 |
|---|---|
| Boiling Point | 392.3ºC at 760mmHg |
| Melting Point | 167-171ºC |
| Molecular Formula | C13H9ClO3 |
| Molecular Weight | 248.66200 |
| Flash Point | 191.1ºC |
| Exact Mass | 248.02400 |
| PSA | 46.53000 |
| LogP | 3.83050 |
| Vapour Pressure | 7.39E-07mmHg at 25°C |
| Index of Refraction | 1.616 |
| InChIKey | YVVCMTFJWOYNJW-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(Oc2ccc(Cl)cc2)cc1 |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H317-H319-H400 |
| Precautionary Statements | P273-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xn: Harmful;N: Dangerous for the environment; |
| Risk Phrases | R22 |
| Safety Phrases | 26-36/37-60-61 |
| RIDADR | UN 3077 9 / PGIII |
| HS Code | 2918990090 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4PBD-Q02-0 |
| 4'-Carboxy-4-chlor-diphenyl-aether |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the safety information for 4-(4-chlorophenoxy)benzoic acid? |
| A: Safety information for 4-(4-chlorophenoxy)benzoic acid: 26-36/37-60-61. |
| Q: What is the molecular weight of 4-(4-chlorophenoxy)benzoic acid? |
| A: Molecular weight of 4-(4-chlorophenoxy)benzoic acid is 248.66200. |
| Q: What is the molecular formula of 4-(4-chlorophenoxy)benzoic acid? |
| A: Molecular formula of 4-(4-chlorophenoxy)benzoic acid is C13H9ClO3. |
| Q: What is the LogP of 4-(4-chlorophenoxy)benzoic acid? |
| A: LogP of 4-(4-chlorophenoxy)benzoic acid is 3.83050. |
| Q: What is the boiling point of 4-(4-chlorophenoxy)benzoic acid? |
| A: Boiling point of 4-(4-chlorophenoxy)benzoic acid is 392.3ºC at 760mmHg. |
| Q: What is the melting point of 4-(4-chlorophenoxy)benzoic acid? |
| A: Melting point of 4-(4-chlorophenoxy)benzoic acid is 167-171ºC. |
| Q: What is the InChIKey of 4-(4-chlorophenoxy)benzoic acid? |
| A: InChIKey of 4-(4-chlorophenoxy)benzoic acid is YVVCMTFJWOYNJW-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 4-(4-chlorophenoxy)benzoic acid? |
| A: Polar surface area (PSA) of 4-(4-chlorophenoxy)benzoic acid is 46.53000. |
| Q: What is the English name of 4-(4-chlorophenoxy)benzoic acid? |
| A: The English name of 4-(4-chlorophenoxy)benzoic acid is 4-(4-chlorophenoxy)benzoic acid. |
| Q: What English synonyms does 4-(4-chlorophenoxy)benzoic acid have? |
| A: English synonyms of 4-(4-chlorophenoxy)benzoic acid: 4PBD-Q02-0, 4'-Carboxy-4-chlor-diphenyl-aether. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |