3-(DIPHENYLPHOSPHINO)BENZOIC ACID
3-(DIPHENYLPHOSPHINO)BENZOIC ACID structure
|
Common Name | 3-(DIPHENYLPHOSPHINO)BENZOIC ACID | ||
|---|---|---|---|---|
| CAS Number | 2129-30-8 | Molecular Weight | 306.29500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H15O2P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-diphenylphosphanylbenzoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H15O2P |
|---|---|
| Molecular Weight | 306.29500 |
| Exact Mass | 306.08100 |
| PSA | 50.89000 |
| LogP | 3.14300 |
| InChIKey | KXILNLYMPCMVPK-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cccc(P(c2ccccc2)c2ccccc2)c1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xn |
|---|---|
| HS Code | 2916399090 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 10 | |
|---|---|
| DownStream 0 | |
CAS#:14378-89-3
CAS#:585-76-2
CAS#:829-85-6
CAS#:618-51-9
CAS#:1079-66-9
CAS#:603-35-0
CAS#:118-91-2
CAS#:403-54-3
CAS#:109-72-8
CAS#:6952-59-6This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| meta-diphenylphosphanylbenzoic asid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 3-diphenylphosphanylbenzoic acid? |
| A: SMILES notation of 3-diphenylphosphanylbenzoic acid is O=C(O)c1cccc(P(c2ccccc2)c2ccccc2)c1. |
| Q: What is the CAS number of 3-diphenylphosphanylbenzoic acid? |
| A: CAS number of 3-diphenylphosphanylbenzoic acid is 2129-30-8. |
| Q: What English synonyms does 3-diphenylphosphanylbenzoic acid have? |
| A: English synonyms of 3-diphenylphosphanylbenzoic acid: meta-diphenylphosphanylbenzoic asid. |
| Q: What is the molecular weight of 3-diphenylphosphanylbenzoic acid? |
| A: Molecular weight of 3-diphenylphosphanylbenzoic acid is 306.29500. |
| Q: What is the molecular formula of 3-diphenylphosphanylbenzoic acid? |
| A: Molecular formula of 3-diphenylphosphanylbenzoic acid is C19H15O2P. |
| Q: What are the upstream materials of 3-diphenylphosphanylbenzoic acid? |
| A: Related upstream materials(CAS) of 3-diphenylphosphanylbenzoic acid: 14378-89-3;585-76-2;829-85-6;618-51-9;1079-66-9;603-35-0;118-91-2;403-54-3;109-72-8;6952-59-6. |
| Q: What is the LogP of 3-diphenylphosphanylbenzoic acid? |
| A: LogP of 3-diphenylphosphanylbenzoic acid is 3.14300. |
| Q: What is the English name of 3-diphenylphosphanylbenzoic acid? |
| A: The English name of 3-diphenylphosphanylbenzoic acid is 3-diphenylphosphanylbenzoic acid. |
| Q: What is the InChIKey of 3-diphenylphosphanylbenzoic acid? |
| A: InChIKey of 3-diphenylphosphanylbenzoic acid is KXILNLYMPCMVPK-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 3-diphenylphosphanylbenzoic acid? |
| A: Polar surface area (PSA) of 3-diphenylphosphanylbenzoic acid is 50.89000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |