1H-Indole-3-aceticacid, 2-methyl-, ethyl ester
1H-Indole-3-aceticacid, 2-methyl-, ethyl ester structure
|
Common Name | 1H-Indole-3-aceticacid, 2-methyl-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 21909-49-9 | Molecular Weight | 217.26400 | |
| Density | 1.158g/cm3 | Boiling Point | 366.1ºC at 760mmHg | |
| Molecular Formula | C13H15NO2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 175.2ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl 2-(2-methyl-1H-indol-3-yl)acetate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.158g/cm3 |
|---|---|
| Boiling Point | 366.1ºC at 760mmHg |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.26400 |
| Flash Point | 175.2ºC |
| Exact Mass | 217.11000 |
| PSA | 42.09000 |
| LogP | 2.58190 |
| Vapour Pressure | 1.5E-05mmHg at 25°C |
| Index of Refraction | n20/D 1.571(lit.) |
| InChIKey | SLEXJGHKKHQSDC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Cc1c(C)[nH]c2ccccc12 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933990090 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| (2-Methyl-indol-3-yl)-essigsaeure-aethylester |
| 2-methylindole-3-acetic acid |
| 2-methyl-1H-indole-3-acetic acid ethyl ester |
| (2-methyl-1H-indol-3-yl)acetic acid ethyl ester |
| Ethyl 2-methyl-3-indoleacetate |
| MFCD02093647 |
| (2-methyl-indol-3-yl)-acetic acid ethyl ester |
| ethyl (2-methylindol-3-yl)acetate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of ethyl 2-(2-methyl-1H-indol-3-yl)acetate? |
| A: Molecular weight of ethyl 2-(2-methyl-1H-indol-3-yl)acetate is 217.26400. |
| Q: What is the polar surface area (PSA) of ethyl 2-(2-methyl-1H-indol-3-yl)acetate? |
| A: Polar surface area (PSA) of ethyl 2-(2-methyl-1H-indol-3-yl)acetate is 42.09000. |
| Q: What English synonyms does ethyl 2-(2-methyl-1H-indol-3-yl)acetate have? |
| A: English synonyms of ethyl 2-(2-methyl-1H-indol-3-yl)acetate: (2-Methyl-indol-3-yl)-essigsaeure-aethylester, 2-methylindole-3-acetic acid, 2-methyl-1H-indole-3-acetic acid ethyl ester, (2-methyl-1H-indol-3-yl)acetic acid ethyl ester, Ethyl 2-methyl-3-indoleacetate, MFCD02093647, (2-methyl-indol-3-yl)-acetic acid ethyl ester, ethyl (2-methylindol-3-yl)acetate. |
| Q: What is the molecular formula of ethyl 2-(2-methyl-1H-indol-3-yl)acetate? |
| A: Molecular formula of ethyl 2-(2-methyl-1H-indol-3-yl)acetate is C13H15NO2. |
| Q: What is the SMILES notation of ethyl 2-(2-methyl-1H-indol-3-yl)acetate? |
| A: SMILES notation of ethyl 2-(2-methyl-1H-indol-3-yl)acetate is CCOC(=O)Cc1c(C)[nH]c2ccccc12. |
| Q: What is the LogP of ethyl 2-(2-methyl-1H-indol-3-yl)acetate? |
| A: LogP of ethyl 2-(2-methyl-1H-indol-3-yl)acetate is 2.58190. |
| Q: What is the InChIKey of ethyl 2-(2-methyl-1H-indol-3-yl)acetate? |
| A: InChIKey of ethyl 2-(2-methyl-1H-indol-3-yl)acetate is SLEXJGHKKHQSDC-UHFFFAOYSA-N. |
| Q: What is the safety information for ethyl 2-(2-methyl-1H-indol-3-yl)acetate? |
| A: Safety information for ethyl 2-(2-methyl-1H-indol-3-yl)acetate: 26-36. |
| Q: What is the boiling point of ethyl 2-(2-methyl-1H-indol-3-yl)acetate? |
| A: Boiling point of ethyl 2-(2-methyl-1H-indol-3-yl)acetate is 366.1ºC at 760mmHg. |
| Q: What is the CAS number of ethyl 2-(2-methyl-1H-indol-3-yl)acetate? |
| A: CAS number of ethyl 2-(2-methyl-1H-indol-3-yl)acetate is 21909-49-9. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |