Ethyl adenine-9-acetate
Ethyl adenine-9-acetate structure
|
Common Name | Ethyl adenine-9-acetate | ||
|---|---|---|---|---|
| CAS Number | 25477-96-7 | Molecular Weight | 221.216 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 443.1±55.0 °C at 760 mmHg | |
| Molecular Formula | C9H11N5O2 | Melting Point | 224-228ºC (dec.)(lit.) | |
| MSDS | N/A | Flash Point | 221.8±31.5 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl 2-(6-aminopurin-9-yl)acetate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 443.1±55.0 °C at 760 mmHg |
| Melting Point | 224-228ºC (dec.)(lit.) |
| Molecular Formula | C9H11N5O2 |
| Molecular Weight | 221.216 |
| Flash Point | 221.8±31.5 °C |
| Exact Mass | 221.091278 |
| PSA | 95.92000 |
| LogP | 0.36 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.699 |
| InChIKey | MCOVDURKZQNFBE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Cn1cnc2c(N)ncnc21 |
| Storage condition | 2-8°C |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Antiproliferative activity against human RL cells assessed as reduction in cell survi...
Source: ChEMBL
Target: RL
External Id: CHEMBL4387963
|
|
Name: Inhibition of recombinant cN-II (unknown origin) assessed as reduction in inorganic p...
Source: ChEMBL
Target: 5'-nucleotidase
External Id: CHEMBL4387948
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Ethyl6-methylsalicylate |
| 9-(ethyloxycarbonylmethyl)-6-aminopurine |
| ethyl 2-(6-amino-9H-purin-9-yl)acetate |
| Ethyl Adenine-9-Acetate |
| Ethyl (adenin-9-yl)acetate |
| ethyl 2-(adenin-9-yl)acetate |
| (6-amino-purin-9-yl)-acetic acid ethyl ester |
| ethyl 2-(9H-adenin-9-yl)acetate |
| adenine-9-acetic acid ethyl ester |
| (adenin-9-yl)-acetic acid ethyl ester |
| 9H-purine-9-acetic acid, 6-amino-, ethyl ester |
| Ethyl (6-amino-9H-purin-9-yl)acetate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the storage conditions for ethyl 2-(6-aminopurin-9-yl)acetate? |
| A: Storage conditions for ethyl 2-(6-aminopurin-9-yl)acetate: 2-8°C. |
| Q: What is the boiling point of ethyl 2-(6-aminopurin-9-yl)acetate? |
| A: Boiling point of ethyl 2-(6-aminopurin-9-yl)acetate is 443.1±55.0 °C at 760 mmHg. |
| Q: What is the molecular weight of ethyl 2-(6-aminopurin-9-yl)acetate? |
| A: Molecular weight of ethyl 2-(6-aminopurin-9-yl)acetate is 221.216. |
| Q: What is the LogP of ethyl 2-(6-aminopurin-9-yl)acetate? |
| A: LogP of ethyl 2-(6-aminopurin-9-yl)acetate is 0.36. |
| Q: What is the English name of ethyl 2-(6-aminopurin-9-yl)acetate? |
| A: The English name of ethyl 2-(6-aminopurin-9-yl)acetate is ethyl 2-(6-aminopurin-9-yl)acetate. |
| Q: What is the SMILES notation of ethyl 2-(6-aminopurin-9-yl)acetate? |
| A: SMILES notation of ethyl 2-(6-aminopurin-9-yl)acetate is CCOC(=O)Cn1cnc2c(N)ncnc21. |
| Q: What is the polar surface area (PSA) of ethyl 2-(6-aminopurin-9-yl)acetate? |
| A: Polar surface area (PSA) of ethyl 2-(6-aminopurin-9-yl)acetate is 95.92000. |
| Q: What is the melting point of ethyl 2-(6-aminopurin-9-yl)acetate? |
| A: Melting point of ethyl 2-(6-aminopurin-9-yl)acetate is 224-228ºC (dec.)(lit.). |
| Q: What is the CAS number of ethyl 2-(6-aminopurin-9-yl)acetate? |
| A: CAS number of ethyl 2-(6-aminopurin-9-yl)acetate is 25477-96-7. |
| Q: What is the molecular formula of ethyl 2-(6-aminopurin-9-yl)acetate? |
| A: Molecular formula of ethyl 2-(6-aminopurin-9-yl)acetate is C9H11N5O2. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |