1-Boc-2-Ethynylpiperidine structure
|
Common Name | 1-Boc-2-Ethynylpiperidine | ||
|---|---|---|---|---|
| CAS Number | 255864-58-5 | Molecular Weight | 209.285 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 269.6±29.0 °C at 760 mmHg | |
| Molecular Formula | C12H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 116.8±24.3 °C | |
| Name | tert-butyl 2-ethynylpiperidine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 269.6±29.0 °C at 760 mmHg |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.285 |
| Flash Point | 116.8±24.3 °C |
| Exact Mass | 209.141586 |
| PSA | 29.54000 |
| LogP | 2.11 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.491 |
| InChIKey | OLYLUYXEZAJXAC-UHFFFAOYSA-N |
| SMILES | C#CC1CCCCN1C(=O)OC(C)(C)C |
| Storage condition | 2-8°C |
| Hazard Codes | T+ |
|---|---|
| RIDADR | 2810.0 |
| Hazard Class | 6.1 |
| HS Code | 2933399090 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-Piperidinecarboxylic acid, 2-ethynyl-, 1,1-dimethylethyl ester |
| 2-Ethynyl-piperidine-1-carboxylic acid tert-butyl ester |
| 1-Boc-2-Ethynylpiperidine |
| 2-Methyl-2-propanyl 2-ethynyl-1-piperidinecarboxylate |
| tert-Butyl 2-ethynylpiperidine-1-carboxylate |