phenyl-beta-d-thioglucopyranoside
phenyl-beta-d-thioglucopyranoside structure
|
Common Name | phenyl-beta-d-thioglucopyranoside | ||
|---|---|---|---|---|
| CAS Number | 2936-70-1 | Molecular Weight | 272.31700 | |
| Density | 1.48 g/cm3 | Boiling Point | 510.7ºC at 760 mmHg | |
| Molecular Formula | C12H16O5S | Melting Point | 135℃ | |
| MSDS | N/A | Flash Point | 262.6ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-phenylsulfanyloxane-3,4,5-triol |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.48 g/cm3 |
|---|---|
| Boiling Point | 510.7ºC at 760 mmHg |
| Melting Point | 135℃ |
| Molecular Formula | C12H16O5S |
| Molecular Weight | 272.31700 |
| Flash Point | 262.6ºC |
| Exact Mass | 272.07200 |
| PSA | 115.45000 |
| Vapour Pressure | 2.98E-11mmHg at 25°C |
| Index of Refraction | 1.667 |
| InChIKey | OVLYAISOYPJBLU-ZIQFBCGOSA-N |
| SMILES | OCC1OC(Sc2ccccc2)C(O)C(O)C1O |
| Storage condition | ?20°C |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| ARK057 |
| Phenyl 1-thio-|A-D-glucopyranoside |
| Phenyl |A-D-thioglucoside |
| Phenyl |A-D-thioglucopyranoside |
| Phenyl1-Thio-beta-D-Glucopyranoside |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-phenylsulfanyloxane-3,4,5-triol? |
| A: Molecular weight of (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-phenylsulfanyloxane-3,4,5-triol is 272.31700. |
| Q: What are the storage conditions for (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-phenylsulfanyloxane-3,4,5-triol? |
| A: Storage conditions for (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-phenylsulfanyloxane-3,4,5-triol: ?20°C. |
| Q: What is the safety information for (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-phenylsulfanyloxane-3,4,5-triol? |
| A: Safety information for (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-phenylsulfanyloxane-3,4,5-triol: 26-36. |
| Q: What is the CAS number of (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-phenylsulfanyloxane-3,4,5-triol? |
| A: CAS number of (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-phenylsulfanyloxane-3,4,5-triol is 2936-70-1. |
| Q: What is the boiling point of (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-phenylsulfanyloxane-3,4,5-triol? |
| A: Boiling point of (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-phenylsulfanyloxane-3,4,5-triol is 510.7ºC at 760 mmHg. |
| Q: What is the InChIKey of (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-phenylsulfanyloxane-3,4,5-triol? |
| A: InChIKey of (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-phenylsulfanyloxane-3,4,5-triol is OVLYAISOYPJBLU-ZIQFBCGOSA-N. |
| Q: What English synonyms does (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-phenylsulfanyloxane-3,4,5-triol have? |
| A: English synonyms of (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-phenylsulfanyloxane-3,4,5-triol: ARK057, Phenyl 1-thio-|A-D-glucopyranoside, Phenyl |A-D-thioglucoside, Phenyl |A-D-thioglucopyranoside, Phenyl1-Thio-beta-D-Glucopyranoside. |
| Q: What is the SMILES notation of (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-phenylsulfanyloxane-3,4,5-triol? |
| A: SMILES notation of (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-phenylsulfanyloxane-3,4,5-triol is OCC1OC(Sc2ccccc2)C(O)C(O)C1O. |
| Q: What is the English name of (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-phenylsulfanyloxane-3,4,5-triol? |
| A: The English name of (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-phenylsulfanyloxane-3,4,5-triol is (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-phenylsulfanyloxane-3,4,5-triol. |
| Q: What is the melting point of (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-phenylsulfanyloxane-3,4,5-triol? |
| A: Melting point of (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-phenylsulfanyloxane-3,4,5-triol is 135℃. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |