N-(4-Aminophenyl)maleimide
N-(4-Aminophenyl)maleimide structure
|
Common Name | N-(4-Aminophenyl)maleimide | ||
|---|---|---|---|---|
| CAS Number | 29753-26-2 | Molecular Weight | 188.183 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 401.0±28.0 °C at 760 mmHg | |
| Molecular Formula | C10H8N2O2 | Melting Point | 173 °C | |
| MSDS | N/A | Flash Point | 196.3±24.0 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(4-aminophenyl)pyrrole-2,5-dione |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 401.0±28.0 °C at 760 mmHg |
| Melting Point | 173 °C |
| Molecular Formula | C10H8N2O2 |
| Molecular Weight | 188.183 |
| Flash Point | 196.3±24.0 °C |
| Exact Mass | 188.058578 |
| PSA | 63.40000 |
| LogP | -0.19 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.688 |
| InChIKey | XOPCHXSYQHXLHJ-UHFFFAOYSA-N |
| SMILES | Nc1ccc(N2C(=O)C=CC2=O)cc1 |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xn |
|---|---|
| Risk Phrases | 22 |
| Safety Phrases | S22-S24/25 |
| WGK Germany | 3 |
| RTECS | TY7137500 |
| HS Code | 29054910 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 4 | |
|---|---|
| DownStream 0 | |
CAS#:108-31-6
CAS#:106-50-3
CAS#:71603-06-0
CAS#:741270-61-1This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N-(4-Aminophenyl)maleimide |
| 1-(4-Aminophenyl)-1H-pyrrole-2,5-dione |
| N-(4-Aminophenyl)-maleimide |
| EINECS 249-824-4 |
| MFCD00051191 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the boiling point of 1-(4-aminophenyl)pyrrole-2,5-dione? |
| A: Boiling point of 1-(4-aminophenyl)pyrrole-2,5-dione is 401.0±28.0 °C at 760 mmHg. |
| Q: What is the SMILES notation of 1-(4-aminophenyl)pyrrole-2,5-dione? |
| A: SMILES notation of 1-(4-aminophenyl)pyrrole-2,5-dione is Nc1ccc(N2C(=O)C=CC2=O)cc1. |
| Q: What is the CAS number of 1-(4-aminophenyl)pyrrole-2,5-dione? |
| A: CAS number of 1-(4-aminophenyl)pyrrole-2,5-dione is 29753-26-2. |
| Q: What is the polar surface area (PSA) of 1-(4-aminophenyl)pyrrole-2,5-dione? |
| A: Polar surface area (PSA) of 1-(4-aminophenyl)pyrrole-2,5-dione is 63.40000. |
| Q: What is the melting point of 1-(4-aminophenyl)pyrrole-2,5-dione? |
| A: Melting point of 1-(4-aminophenyl)pyrrole-2,5-dione is 173 °C. |
| Q: What is the English name of 1-(4-aminophenyl)pyrrole-2,5-dione? |
| A: The English name of 1-(4-aminophenyl)pyrrole-2,5-dione is 1-(4-aminophenyl)pyrrole-2,5-dione. |
| Q: What is the molecular formula of 1-(4-aminophenyl)pyrrole-2,5-dione? |
| A: Molecular formula of 1-(4-aminophenyl)pyrrole-2,5-dione is C10H8N2O2. |
| Q: What English synonyms does 1-(4-aminophenyl)pyrrole-2,5-dione have? |
| A: English synonyms of 1-(4-aminophenyl)pyrrole-2,5-dione: N-(4-Aminophenyl)maleimide, 1-(4-Aminophenyl)-1H-pyrrole-2,5-dione, N-(4-Aminophenyl)-maleimide, EINECS 249-824-4, MFCD00051191. |
| Q: What is the safety information for 1-(4-aminophenyl)pyrrole-2,5-dione? |
| A: Safety information for 1-(4-aminophenyl)pyrrole-2,5-dione: S22-S24/25. |
| Q: What is the InChIKey of 1-(4-aminophenyl)pyrrole-2,5-dione? |
| A: InChIKey of 1-(4-aminophenyl)pyrrole-2,5-dione is XOPCHXSYQHXLHJ-UHFFFAOYSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |