5,6-diaminopyrimidine-2,4-diol
5,6-diaminopyrimidine-2,4-diol structure
|
Common Name | 5,6-diaminopyrimidine-2,4-diol | ||
|---|---|---|---|---|
| CAS Number | 32014-70-3 | Molecular Weight | 240.20 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 583.5±60.0 °C at 760 mmHg | |
| Molecular Formula | C4H8N4O6S | Melting Point | >260 °C (dec.)(lit.) | |
| MSDS | Chinese USA | Flash Point | 306.7±32.9 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5,6-diamino-2,4-dihydroxypyrimidine sulfate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 583.5±60.0 °C at 760 mmHg |
| Melting Point | >260 °C (dec.)(lit.) |
| Molecular Formula | C4H8N4O6S |
| Molecular Weight | 240.20 |
| Flash Point | 306.7±32.9 °C |
| Exact Mass | 240.01645516 |
| PSA | 118.28000 |
| LogP | -1.92 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.855 |
| InChIKey | IKARJSDZQCSEJX-UHFFFAOYSA-N |
| SMILES | C1(=C(NC(=O)NC1=O)N)N.OS(=O)(=O)O |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | YQ9625000 |
| HS Code | 2933599090 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:5807-13-6This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 5,6-Diaminopyrimidine-2,4(1H,3H)-dione |
| 5,6-diamino-1H-pyrimidine-2,4-dione,sulfate |
| 5,6-Diamino-2,4-dihydroxypyrimidine |
| 5,6-Diaminopyrimidine-2,4-diol sulfate |
| 5,6-diaminopyrimidine-2,4-diol |
| MFCD00135845 |
| 5,6-diaminouracil hemisulfate |
| 5,6-Diamino-1H-pyrimidin-2,4-dion,Sulfat |
| 5,6-Diamino-2,4(1H,3H)-pyrimidinedione |
| 4,5-Diamino-2,6-dihydropyrimidine |
| bis(5,6-diaminouracil) sulphate |
| 4,5-DIAMINO-2,6-DIHYDROXYPYRIMIDINE |
| 5,6-diaMino-2,4-pyriMidinediol |
| 5,6-Diaminouracil sulfate |
| 5,6-Diaminouracil sulfate salt |
| 5,6-bis(azanyl)-1H-pyrimidine-2,4-dione |
| 4,5-DIAMINOURACIL SULFATE |
| EINECS 250-899-0 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 5,6-diamino-2,4-dihydroxypyrimidine sulfate? |
| A: Molecular formula of 5,6-diamino-2,4-dihydroxypyrimidine sulfate is C4H8N4O6S. |
| Q: What is the boiling point of 5,6-diamino-2,4-dihydroxypyrimidine sulfate? |
| A: Boiling point of 5,6-diamino-2,4-dihydroxypyrimidine sulfate is 583.5±60.0 °C at 760 mmHg. |
| Q: What is the molecular weight of 5,6-diamino-2,4-dihydroxypyrimidine sulfate? |
| A: Molecular weight of 5,6-diamino-2,4-dihydroxypyrimidine sulfate is 240.20. |
| Q: What is the SMILES notation of 5,6-diamino-2,4-dihydroxypyrimidine sulfate? |
| A: SMILES notation of 5,6-diamino-2,4-dihydroxypyrimidine sulfate is C1(=C(NC(=O)NC1=O)N)N.OS(=O)(=O)O. |
| Q: What is the polar surface area (PSA) of 5,6-diamino-2,4-dihydroxypyrimidine sulfate? |
| A: Polar surface area (PSA) of 5,6-diamino-2,4-dihydroxypyrimidine sulfate is 118.28000. |
| Q: What is the melting point of 5,6-diamino-2,4-dihydroxypyrimidine sulfate? |
| A: Melting point of 5,6-diamino-2,4-dihydroxypyrimidine sulfate is >260 °C (dec.)(lit.). |
| Q: What is the CAS number of 5,6-diamino-2,4-dihydroxypyrimidine sulfate? |
| A: CAS number of 5,6-diamino-2,4-dihydroxypyrimidine sulfate is 32014-70-3. |
| Q: What is the LogP of 5,6-diamino-2,4-dihydroxypyrimidine sulfate? |
| A: LogP of 5,6-diamino-2,4-dihydroxypyrimidine sulfate is -1.92. |
| Q: What is the English name of 5,6-diamino-2,4-dihydroxypyrimidine sulfate? |
| A: The English name of 5,6-diamino-2,4-dihydroxypyrimidine sulfate is 5,6-diamino-2,4-dihydroxypyrimidine sulfate. |
| Q: What are the downstream products of 5,6-diamino-2,4-dihydroxypyrimidine sulfate? |
| A: Related downstream products(CAS) of 5,6-diamino-2,4-dihydroxypyrimidine sulfate: 5807-13-6. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |