1-BOC-3-CBZ-AMINOPYRROLIDINE
1-BOC-3-CBZ-AMINOPYRROLIDINE structure
|
Common Name | 1-BOC-3-CBZ-AMINOPYRROLIDINE | ||
|---|---|---|---|---|
| CAS Number | 325775-36-8 | Molecular Weight | 320.38300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H24N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | tert-butyl 3-{[(benzyloxy)carbonyl]amino}-1-pyrrolidinecarboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H24N2O4 |
|---|---|
| Molecular Weight | 320.38300 |
| Exact Mass | 320.17400 |
| PSA | 67.87000 |
| LogP | 3.25100 |
| InChIKey | WLSYDQGCKDPQPL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(NC(=O)OCc2ccccc2)C1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xn |
|---|---|
| HS Code | 2933990090 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:115551-46-7
CAS#:186550-13-0This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-Boc-3-Cbz-aminopyrrolidine |
| 2-Methyl-2-Propanyl 3-{[(Benzyloxy)Carbonyl]Amino}-1-Pyrrolidinecarboxylate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of tert-butyl 3-{[(benzyloxy)carbonyl]amino}-1-pyrrolidinecarboxylate? |
| A: CAS number of tert-butyl 3-{[(benzyloxy)carbonyl]amino}-1-pyrrolidinecarboxylate is 325775-36-8. |
| Q: What English synonyms does tert-butyl 3-{[(benzyloxy)carbonyl]amino}-1-pyrrolidinecarboxylate have? |
| A: English synonyms of tert-butyl 3-{[(benzyloxy)carbonyl]amino}-1-pyrrolidinecarboxylate: 1-Boc-3-Cbz-aminopyrrolidine, 2-Methyl-2-Propanyl 3-{[(Benzyloxy)Carbonyl]Amino}-1-Pyrrolidinecarboxylate. |
| Q: What is the LogP of tert-butyl 3-{[(benzyloxy)carbonyl]amino}-1-pyrrolidinecarboxylate? |
| A: LogP of tert-butyl 3-{[(benzyloxy)carbonyl]amino}-1-pyrrolidinecarboxylate is 3.25100. |
| Q: What is the molecular formula of tert-butyl 3-{[(benzyloxy)carbonyl]amino}-1-pyrrolidinecarboxylate? |
| A: Molecular formula of tert-butyl 3-{[(benzyloxy)carbonyl]amino}-1-pyrrolidinecarboxylate is C17H24N2O4. |
| Q: What is the polar surface area (PSA) of tert-butyl 3-{[(benzyloxy)carbonyl]amino}-1-pyrrolidinecarboxylate? |
| A: Polar surface area (PSA) of tert-butyl 3-{[(benzyloxy)carbonyl]amino}-1-pyrrolidinecarboxylate is 67.87000. |
| Q: What is the SMILES notation of tert-butyl 3-{[(benzyloxy)carbonyl]amino}-1-pyrrolidinecarboxylate? |
| A: SMILES notation of tert-butyl 3-{[(benzyloxy)carbonyl]amino}-1-pyrrolidinecarboxylate is CC(C)(C)OC(=O)N1CCC(NC(=O)OCc2ccccc2)C1. |
| Q: What are the downstream products of tert-butyl 3-{[(benzyloxy)carbonyl]amino}-1-pyrrolidinecarboxylate? |
| A: Related downstream products(CAS) of tert-butyl 3-{[(benzyloxy)carbonyl]amino}-1-pyrrolidinecarboxylate: 115551-46-7;186550-13-0. |
| Q: What is the InChIKey of tert-butyl 3-{[(benzyloxy)carbonyl]amino}-1-pyrrolidinecarboxylate? |
| A: InChIKey of tert-butyl 3-{[(benzyloxy)carbonyl]amino}-1-pyrrolidinecarboxylate is WLSYDQGCKDPQPL-UHFFFAOYSA-N. |
| Q: What is the English name of tert-butyl 3-{[(benzyloxy)carbonyl]amino}-1-pyrrolidinecarboxylate? |
| A: The English name of tert-butyl 3-{[(benzyloxy)carbonyl]amino}-1-pyrrolidinecarboxylate is tert-butyl 3-{[(benzyloxy)carbonyl]amino}-1-pyrrolidinecarboxylate. |
| Q: What is the molecular weight of tert-butyl 3-{[(benzyloxy)carbonyl]amino}-1-pyrrolidinecarboxylate? |
| A: Molecular weight of tert-butyl 3-{[(benzyloxy)carbonyl]amino}-1-pyrrolidinecarboxylate is 320.38300. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |