2-Carboxyquinoline 1-oxide
2-Carboxyquinoline 1-oxide structure
|
Common Name | 2-Carboxyquinoline 1-oxide | ||
|---|---|---|---|---|
| CAS Number | 3297-64-1 | Molecular Weight | 189.16700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H7NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-oxidoquinolin-1-ium-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H7NO3 |
|---|---|
| Molecular Weight | 189.16700 |
| Exact Mass | 189.04300 |
| PSA | 62.76000 |
| LogP | 1.96650 |
| InChIKey | CAGGDJBSADVXFV-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc2ccccc2[n+]1[O-] |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xn |
|---|---|
| HS Code | 2933499090 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 9 | |
|---|---|
| DownStream 2 | |
CAS#:93-10-7
CAS#:1076-28-4
CAS#:83260-82-6
CAS#:40449-19-2
CAS#:83813-56-3
CAS#:76278-23-4
CAS#:75003-44-0
CAS#:95113-34-1
CAS#:83492-19-7
CAS#:5659-33-6This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-oxido-quinolin-1-ium-2-carboxylic acid |
| 1-oxy-quinoline-2-carboxylic acid |
| 2-Quinolinecarboxylic acid,1-oxide |
| quinoline-N-oxide-2-carboxylic acid |
| quinaldic acid N-oxide |
| 2-carboxylic acid-quinoline-N-oxide |
| quinoline-2-carboxylic acid-1-oxide |
| quinoleic acid N-oxide |
| quinoline-2-carboxylic acid N-oxide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 1-oxidoquinolin-1-ium-2-carboxylic acid? |
| A: SMILES notation of 1-oxidoquinolin-1-ium-2-carboxylic acid is O=C(O)c1ccc2ccccc2[n+]1[O-]. |
| Q: What are the upstream materials of 1-oxidoquinolin-1-ium-2-carboxylic acid? |
| A: Related upstream materials(CAS) of 1-oxidoquinolin-1-ium-2-carboxylic acid: 93-10-7;1076-28-4;83260-82-6;40449-19-2;83813-56-3;76278-23-4;75003-44-0;95113-34-1;83492-19-7. |
| Q: What is the LogP of 1-oxidoquinolin-1-ium-2-carboxylic acid? |
| A: LogP of 1-oxidoquinolin-1-ium-2-carboxylic acid is 1.96650. |
| Q: What is the polar surface area (PSA) of 1-oxidoquinolin-1-ium-2-carboxylic acid? |
| A: Polar surface area (PSA) of 1-oxidoquinolin-1-ium-2-carboxylic acid is 62.76000. |
| Q: What is the molecular weight of 1-oxidoquinolin-1-ium-2-carboxylic acid? |
| A: Molecular weight of 1-oxidoquinolin-1-ium-2-carboxylic acid is 189.16700. |
| Q: What is the English name of 1-oxidoquinolin-1-ium-2-carboxylic acid? |
| A: The English name of 1-oxidoquinolin-1-ium-2-carboxylic acid is 1-oxidoquinolin-1-ium-2-carboxylic acid. |
| Q: What English synonyms does 1-oxidoquinolin-1-ium-2-carboxylic acid have? |
| A: English synonyms of 1-oxidoquinolin-1-ium-2-carboxylic acid: 1-oxido-quinolin-1-ium-2-carboxylic acid, 1-oxy-quinoline-2-carboxylic acid, 2-Quinolinecarboxylic acid,1-oxide, quinoline-N-oxide-2-carboxylic acid, quinaldic acid N-oxide, 2-carboxylic acid-quinoline-N-oxide, quinoline-2-carboxylic acid-1-oxide, quinoleic acid N-oxide, quinoline-2-carboxylic acid N-oxide. |
| Q: What is the CAS number of 1-oxidoquinolin-1-ium-2-carboxylic acid? |
| A: CAS number of 1-oxidoquinolin-1-ium-2-carboxylic acid is 3297-64-1. |
| Q: What is the InChIKey of 1-oxidoquinolin-1-ium-2-carboxylic acid? |
| A: InChIKey of 1-oxidoquinolin-1-ium-2-carboxylic acid is CAGGDJBSADVXFV-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 1-oxidoquinolin-1-ium-2-carboxylic acid? |
| A: Molecular formula of 1-oxidoquinolin-1-ium-2-carboxylic acid is C10H7NO3. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |