CIS-5-BENZYL-2-BOC-HEXAHYDROPYRROLO[3,4-C]PYRROLE
![CIS-5-BENZYL-2-BOC-HEXAHYDROPYRROLO[3,4-C]PYRROLE Structure](https://image.chemsrc.com/caspic/183/370879-56-4.png)
CIS-5-BENZYL-2-BOC-HEXAHYDROPYRROLO[3,4-C]PYRROLE structure
|
Common Name | CIS-5-BENZYL-2-BOC-HEXAHYDROPYRROLO[3,4-C]PYRROLE | ||
|---|---|---|---|---|
| CAS Number | 370879-56-4 | Molecular Weight | 302.41100 | |
| Density | 1.117g/cm3 | Boiling Point | 393.4ºC at 760mmHg | |
| Molecular Formula | C18H26N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.7ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | tert-butyl (3aR,6aS)-2-benzyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.117g/cm3 |
|---|---|
| Boiling Point | 393.4ºC at 760mmHg |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.41100 |
| Flash Point | 191.7ºC |
| Exact Mass | 302.19900 |
| PSA | 32.78000 |
| LogP | 2.86110 |
| Index of Refraction | 1.554 |
| InChIKey | WUEVXPVJRUPJLC-IYBDPMFKSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2CN(Cc3ccccc3)CC2C1 |
| Storage condition | 2-8°C |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi |
|---|
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 1 | |
![2-Benzyloctahydropyrrolo[3,4-c]pyrrole Structure](https://image.chemsrc.com/caspic/338/172739-04-7.png)
CAS#:172739-04-7
CAS#:24424-99-5![cis-2-Boc-hexahydropyrrolo[3,4-c]pyrrole structure](https://image.chemsrc.com/caspic/402/250275-15-1.png)
CAS#:250275-15-1This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| cis-5-Benzyl-2-Boc-hexahydropyrrolo[3,4-c]pyrrole |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does tert-butyl (3aR,6aS)-2-benzyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate have? |
| A: English synonyms of tert-butyl (3aR,6aS)-2-benzyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate: cis-5-Benzyl-2-Boc-hexahydropyrrolo[3,4-c]pyrrole. |
| Q: What is the English name of tert-butyl (3aR,6aS)-2-benzyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate? |
| A: The English name of tert-butyl (3aR,6aS)-2-benzyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate is tert-butyl (3aR,6aS)-2-benzyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate. |
| Q: What is the molecular weight of tert-butyl (3aR,6aS)-2-benzyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate? |
| A: Molecular weight of tert-butyl (3aR,6aS)-2-benzyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate is 302.41100. |
| Q: What is the InChIKey of tert-butyl (3aR,6aS)-2-benzyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate? |
| A: InChIKey of tert-butyl (3aR,6aS)-2-benzyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate is WUEVXPVJRUPJLC-IYBDPMFKSA-N. |
| Q: What are the upstream materials of tert-butyl (3aR,6aS)-2-benzyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate? |
| A: Related upstream materials(CAS) of tert-butyl (3aR,6aS)-2-benzyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate: 172739-04-7;24424-99-5. |
| Q: What are the downstream products of tert-butyl (3aR,6aS)-2-benzyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate? |
| A: Related downstream products(CAS) of tert-butyl (3aR,6aS)-2-benzyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate: 250275-15-1. |
| Q: What are the storage conditions for tert-butyl (3aR,6aS)-2-benzyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate? |
| A: Storage conditions for tert-butyl (3aR,6aS)-2-benzyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate: 2-8°C. |
| Q: What is the polar surface area (PSA) of tert-butyl (3aR,6aS)-2-benzyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate? |
| A: Polar surface area (PSA) of tert-butyl (3aR,6aS)-2-benzyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate is 32.78000. |
| Q: What is the boiling point of tert-butyl (3aR,6aS)-2-benzyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate? |
| A: Boiling point of tert-butyl (3aR,6aS)-2-benzyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate is 393.4ºC at 760mmHg. |
| Q: What is the molecular formula of tert-butyl (3aR,6aS)-2-benzyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate? |
| A: Molecular formula of tert-butyl (3aR,6aS)-2-benzyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate is C18H26N2O2. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |