3-Formyl-1H-indole-7-carbonitrile
3-Formyl-1H-indole-7-carbonitrile structure
|
Common Name | 3-Formyl-1H-indole-7-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 467451-63-4 | Molecular Weight | 170.167 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 429.6±25.0 °C at 760 mmHg | |
| Molecular Formula | C10H6N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.6±23.2 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-Formyl-1H-indole-7-carbonitrile |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 429.6±25.0 °C at 760 mmHg |
| Molecular Formula | C10H6N2O |
| Molecular Weight | 170.167 |
| Flash Point | 213.6±23.2 °C |
| Exact Mass | 170.048019 |
| PSA | 56.65000 |
| LogP | 1.12 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.674 |
| InChIKey | WFXZKENGRJYLOG-UHFFFAOYSA-N |
| SMILES | N#Cc1cccc2c(C=O)c[nH]c12 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
CAS#:96631-87-7
CAS#:68-12-2This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-Formyl-1H-indole-7-carbonitrile |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 3-Formyl-1H-indole-7-carbonitrile have? |
| A: English synonyms of 3-Formyl-1H-indole-7-carbonitrile: 3-Formyl-1H-indole-7-carbonitrile. |
| Q: What is the InChIKey of 3-Formyl-1H-indole-7-carbonitrile? |
| A: InChIKey of 3-Formyl-1H-indole-7-carbonitrile is WFXZKENGRJYLOG-UHFFFAOYSA-N. |
| Q: What is the boiling point of 3-Formyl-1H-indole-7-carbonitrile? |
| A: Boiling point of 3-Formyl-1H-indole-7-carbonitrile is 429.6±25.0 °C at 760 mmHg. |
| Q: What is the polar surface area (PSA) of 3-Formyl-1H-indole-7-carbonitrile? |
| A: Polar surface area (PSA) of 3-Formyl-1H-indole-7-carbonitrile is 56.65000. |
| Q: What is the molecular weight of 3-Formyl-1H-indole-7-carbonitrile? |
| A: Molecular weight of 3-Formyl-1H-indole-7-carbonitrile is 170.167. |
| Q: What is the molecular formula of 3-Formyl-1H-indole-7-carbonitrile? |
| A: Molecular formula of 3-Formyl-1H-indole-7-carbonitrile is C10H6N2O. |
| Q: What is the LogP of 3-Formyl-1H-indole-7-carbonitrile? |
| A: LogP of 3-Formyl-1H-indole-7-carbonitrile is 1.12. |
| Q: What is the CAS number of 3-Formyl-1H-indole-7-carbonitrile? |
| A: CAS number of 3-Formyl-1H-indole-7-carbonitrile is 467451-63-4. |
| Q: What is the SMILES notation of 3-Formyl-1H-indole-7-carbonitrile? |
| A: SMILES notation of 3-Formyl-1H-indole-7-carbonitrile is N#Cc1cccc2c(C=O)c[nH]c12. |
| Q: What are the upstream materials of 3-Formyl-1H-indole-7-carbonitrile? |
| A: Related upstream materials(CAS) of 3-Formyl-1H-indole-7-carbonitrile: 96631-87-7;68-12-2. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |