1-[4-(Trifluoromethyl)phenyl]cyclopropanamine
![1-[4-(Trifluoromethyl)phenyl]cyclopropanamine Structure](https://image.chemsrc.com/caspic/432/474709-86-9.png)
1-[4-(Trifluoromethyl)phenyl]cyclopropanamine structure
|
Common Name | 1-[4-(Trifluoromethyl)phenyl]cyclopropanamine | ||
|---|---|---|---|---|
| CAS Number | 474709-86-9 | Molecular Weight | 201.188 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 226.7±40.0 °C at 760 mmHg | |
| Molecular Formula | C10H10F3N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 96.3±20.1 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(4-(Trifluoromethyl)phenyl)cyclopropanamine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 226.7±40.0 °C at 760 mmHg |
| Molecular Formula | C10H10F3N |
| Molecular Weight | 201.188 |
| Flash Point | 96.3±20.1 °C |
| Exact Mass | 201.076538 |
| PSA | 26.02000 |
| LogP | 1.94 |
| Vapour Pressure | 0.1±0.4 mmHg at 25°C |
| Index of Refraction | 1.507 |
| InChIKey | RFWYCBTXBMMOBH-UHFFFAOYSA-N |
| SMILES | NC1(c2ccc(C(F)(F)F)cc2)CC1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1-[4-(Trifluoro... CAS#:474709-86-9 |
| Literature: Glenmark Pharmaceuticals S.A. Patent: US2012/108583 A1, 2012 ; Location in patent: Page/Page column 34 ; US 20120108583 A1 |
|
~%
1-[4-(Trifluoro... CAS#:474709-86-9 |
| Literature: Eisai Co., Ltd. Patent: EP1382603 A1, 2004 ; Location in patent: Page 160 ; |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-[4-(Trifluoromethyl)phenyl]cyclopropanamine |
| 1-[4-(trifluoromethyl)phenyl]cyclopropan-1-amine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 1-(4-(Trifluoromethyl)phenyl)cyclopropanamine? |
| A: Molecular formula of 1-(4-(Trifluoromethyl)phenyl)cyclopropanamine is C10H10F3N. |
| Q: What is the molecular weight of 1-(4-(Trifluoromethyl)phenyl)cyclopropanamine? |
| A: Molecular weight of 1-(4-(Trifluoromethyl)phenyl)cyclopropanamine is 201.188. |
| Q: What English synonyms does 1-(4-(Trifluoromethyl)phenyl)cyclopropanamine have? |
| A: English synonyms of 1-(4-(Trifluoromethyl)phenyl)cyclopropanamine: 1-[4-(Trifluoromethyl)phenyl]cyclopropanamine, 1-[4-(trifluoromethyl)phenyl]cyclopropan-1-amine. |
| Q: What is the SMILES notation of 1-(4-(Trifluoromethyl)phenyl)cyclopropanamine? |
| A: SMILES notation of 1-(4-(Trifluoromethyl)phenyl)cyclopropanamine is NC1(c2ccc(C(F)(F)F)cc2)CC1. |
| Q: What is the LogP of 1-(4-(Trifluoromethyl)phenyl)cyclopropanamine? |
| A: LogP of 1-(4-(Trifluoromethyl)phenyl)cyclopropanamine is 1.94. |
| Q: What is the InChIKey of 1-(4-(Trifluoromethyl)phenyl)cyclopropanamine? |
| A: InChIKey of 1-(4-(Trifluoromethyl)phenyl)cyclopropanamine is RFWYCBTXBMMOBH-UHFFFAOYSA-N. |
| Q: What is the English name of 1-(4-(Trifluoromethyl)phenyl)cyclopropanamine? |
| A: The English name of 1-(4-(Trifluoromethyl)phenyl)cyclopropanamine is 1-(4-(Trifluoromethyl)phenyl)cyclopropanamine. |
| Q: What are the upstream materials of 1-(4-(Trifluoromethyl)phenyl)cyclopropanamine? |
| A: Related upstream materials(CAS) of 1-(4-(Trifluoromethyl)phenyl)cyclopropanamine: 455-18-5;925-90-6;2338-75-2. |
| Q: What is the polar surface area (PSA) of 1-(4-(Trifluoromethyl)phenyl)cyclopropanamine? |
| A: Polar surface area (PSA) of 1-(4-(Trifluoromethyl)phenyl)cyclopropanamine is 26.02000. |
| Q: What is the boiling point of 1-(4-(Trifluoromethyl)phenyl)cyclopropanamine? |
| A: Boiling point of 1-(4-(Trifluoromethyl)phenyl)cyclopropanamine is 226.7±40.0 °C at 760 mmHg. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |