2-PHENYLAMINO-TEREPHTHALIC ACID
2-PHENYLAMINO-TEREPHTHALIC ACID structure
|
Common Name | 2-PHENYLAMINO-TEREPHTHALIC ACID | ||
|---|---|---|---|---|
| CAS Number | 566155-75-7 | Molecular Weight | 257.24100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 2-(Phenylamino)terephthalic acid, also known as 2-phenylaminoterephthalic acid, with Chinese name 2-苯氨基对苯二甲酸, CAS number 566155-75-7, molecular formula C14H11NO4, and molecular weight 257.24100. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-anilinoterephthalic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H11NO4 |
|---|---|
| Molecular Weight | 257.24100 |
| Exact Mass | 257.06900 |
| PSA | 86.63000 |
| LogP | 2.89960 |
| InChIKey | NGZJULVKWHXKMF-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(C(=O)O)c(Nc2ccccc2)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 6 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 5-phenylamino-terephthalic acid |
| Anilino-terephthalsaeure |
| anilino-terephthalic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2-anilinoterephthalic acid? |
| A: InChIKey of 2-anilinoterephthalic acid is NGZJULVKWHXKMF-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 2-anilinoterephthalic acid? |
| A: SMILES notation of 2-anilinoterephthalic acid is O=C(O)c1ccc(C(=O)O)c(Nc2ccccc2)c1. |
| Q: What English synonyms does 2-anilinoterephthalic acid have? |
| A: English synonyms of 2-anilinoterephthalic acid: 5-phenylamino-terephthalic acid, Anilino-terephthalsaeure, anilino-terephthalic acid. |
| Q: What is the English name of 2-anilinoterephthalic acid? |
| A: The English name of 2-anilinoterephthalic acid is 2-anilinoterephthalic acid. |
| Q: What is the molecular weight of 2-anilinoterephthalic acid? |
| A: Molecular weight of 2-anilinoterephthalic acid is 257.24100. |
| Q: What is the molecular formula of 2-anilinoterephthalic acid? |
| A: Molecular formula of 2-anilinoterephthalic acid is C14H11NO4. |
| Q: What is the LogP of 2-anilinoterephthalic acid? |
| A: LogP of 2-anilinoterephthalic acid is 2.89960. |
| Q: What is the polar surface area (PSA) of 2-anilinoterephthalic acid? |
| A: Polar surface area (PSA) of 2-anilinoterephthalic acid is 86.63000. |
| Q: What are the upstream materials of 2-anilinoterephthalic acid? |
| A: Related upstream materials(CAS) of 2-anilinoterephthalic acid: 566155-74-6;586-35-6;18643-86-2;10312-55-7;1829-22-7;165534-79-2. |
| Q: What is the CAS number of 2-anilinoterephthalic acid? |
| A: CAS number of 2-anilinoterephthalic acid is 566155-75-7. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |