Dimethyl iodoterephthalate
Modify Date: 2025-09-11 09:01:39
Dimethyl iodoterephthalate structure
|
Common Name | Dimethyl iodoterephthalate | ||
|---|---|---|---|---|
| CAS Number | 165534-79-2 | Molecular Weight | 320.08100 | |
| Density | 1.708g/cm3 | Boiling Point | 144ºC | |
| Molecular Formula | C10H9IO4 | Melting Point | 81ºC | |
| MSDS | N/A | Flash Point | 166.7ºC | |
| Name | Dimethyl iodoterephthalate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.708g/cm3 |
|---|---|
| Boiling Point | 144ºC |
| Melting Point | 81ºC |
| Molecular Formula | C10H9IO4 |
| Molecular Weight | 320.08100 |
| Flash Point | 166.7ºC |
| Exact Mass | 319.95500 |
| PSA | 52.60000 |
| LogP | 1.86440 |
| Vapour Pressure | 3.97E-05mmHg at 25°C |
| Index of Refraction | 1.584 |
| InChIKey | GJVIVAYVYHUGOO-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(I)c1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2917399090 |
|
~64%
Dimethyl iodote... CAS#:165534-79-2 |
| Literature: Journal of Materials Chemistry, , vol. 22, # 3 p. 1180 - 1190 |
|
~%
Dimethyl iodote... CAS#:165534-79-2 |
| Literature: Chemische Berichte, , vol. 26, p. 2951 |
| Precursor 2 | |
|---|---|
| DownStream 6 | |
CAS#:1829-22-7
CAS#:299173-24-3
CAS#:1186377-08-1
CAS#:566155-74-6
CAS#:566155-75-7
CAS#:385416-64-8| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| dimethyl 2-iodobenzene-1,4-dicarboxylate |