5-Bromo-3-(trifluoromethyl)-1H-indazole
Modify Date: 2026-08-06 07:00:05
5-Bromo-3-(trifluoromethyl)-1H-indazole structure
|
Common Name | 5-Bromo-3-(trifluoromethyl)-1H-indazole | ||
|---|---|---|---|---|
| CAS Number | 57631-11-5 | Molecular Weight | 265.030 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 328.1±37.0 °C at 760 mmHg | |
| Molecular Formula | C8H4BrF3N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 152.3±26.5 °C | |
| Name | 5-Bromo-3-(trifluoromethyl)-1H-indazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 328.1±37.0 °C at 760 mmHg |
| Molecular Formula | C8H4BrF3N2 |
| Molecular Weight | 265.030 |
| Flash Point | 152.3±26.5 °C |
| Exact Mass | 263.950989 |
| PSA | 28.68000 |
| LogP | 3.56 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.596 |
| InChIKey | DSAREEUXBAIGHA-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1[nH]nc2ccc(Br)cc12 |
| Hazard Codes | T+ |
|---|---|
| RIDADR | 2811.0 |
|
~43%
5-Bromo-3-(trif... CAS#:57631-11-5 |
| Literature: AMR TECHNOLOGY, INC. Patent: WO2008/86404 A1, 2008 ; Location in patent: Page/Page column 126-127 ; WO 2008/086404 A1 |
|
~%
5-Bromo-3-(trif... CAS#:57631-11-5 |
| Literature: Produits Chimiques Ugine Kuhlmann Patent: US4051145 A1, 1977 ; |
|
~%
5-Bromo-3-(trif... CAS#:57631-11-5 |
| Literature: Zhu, Gui-Dong; Gong, Jianchun; Gandhi, Viraj B.; Woods, Keith; Luo, Yan; Liu, Xuesong; Guan, Ran; Klinghofer, Vered; Johnson, Eric F.; Stoll, Vincent S.; Mamo, Mulugeta; Li, Qun; Rosenberg, Saul H.; Giranda, Vincent L. Bioorganic and Medicinal Chemistry, 2007 , vol. 15, # 6 p. 2441 - 2452 |
CAS#:929617-37-8| 5-Bromo-3-(trifluoromethyl)-1H-indazole |
| 5-bromo-3-(trifluoromethyl)-2H-indazole |