3-fluoro-4-methoxy-5-nitrobenzoic acid
3-fluoro-4-methoxy-5-nitrobenzoic acid structure
|
Common Name | 3-fluoro-4-methoxy-5-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 577-39-9 | Molecular Weight | 215.13500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H6FNO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 3-Fluoro-4-methoxy-5-nitrobenzoic acid (Chinese name: 3-氟-4-甲氧基-5-硝基苯甲酸, CAS number: 577-39-9) is an organic compound with molecular formula C8H6FNO5 and molecular weight 215.13500. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-fluoro-4-methoxy-5-nitro-benzoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H6FNO5 |
|---|---|
| Molecular Weight | 215.13500 |
| Exact Mass | 215.02300 |
| PSA | 92.35000 |
| LogP | 1.96390 |
| InChIKey | FZVATVOZGBMDRQ-UHFFFAOYSA-N |
| SMILES | COc1c(F)cc(C(=O)O)cc1[N+](=O)[O-] |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xn |
|---|
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:329-46-4This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-Fluor-4-methoxy-5-nitro-benzoesaeure |
| 3-Fluoro-4-methoxy-5-nitrobenzoic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 577-39-9? |
| A: Chinese name of 577-39-9 is 577-39-9. |
| Q: What is the molecular formula of 3-fluoro-4-methoxy-5-nitro-benzoic acid? |
| A: Molecular formula of 3-fluoro-4-methoxy-5-nitro-benzoic acid is C8H6FNO5. |
| Q: What is the polar surface area (PSA) of 3-fluoro-4-methoxy-5-nitro-benzoic acid? |
| A: Polar surface area (PSA) of 3-fluoro-4-methoxy-5-nitro-benzoic acid is 92.35000. |
| Q: What English synonyms does 3-fluoro-4-methoxy-5-nitro-benzoic acid have? |
| A: English synonyms of 3-fluoro-4-methoxy-5-nitro-benzoic acid: 3-Fluor-4-methoxy-5-nitro-benzoesaeure, 3-Fluoro-4-methoxy-5-nitrobenzoic acid. |
| Q: What is the SMILES notation of 3-fluoro-4-methoxy-5-nitro-benzoic acid? |
| A: SMILES notation of 3-fluoro-4-methoxy-5-nitro-benzoic acid is COc1c(F)cc(C(=O)O)cc1[N+](=O)[O-]. |
| Q: What is the English name of 3-fluoro-4-methoxy-5-nitro-benzoic acid? |
| A: The English name of 3-fluoro-4-methoxy-5-nitro-benzoic acid is 3-fluoro-4-methoxy-5-nitro-benzoic acid. |
| Q: What is the LogP of 3-fluoro-4-methoxy-5-nitro-benzoic acid? |
| A: LogP of 3-fluoro-4-methoxy-5-nitro-benzoic acid is 1.96390. |
| Q: What are the downstream products of 3-fluoro-4-methoxy-5-nitro-benzoic acid? |
| A: Related downstream products(CAS) of 3-fluoro-4-methoxy-5-nitro-benzoic acid: 329-46-4. |
| Q: What is the CAS number of 3-fluoro-4-methoxy-5-nitro-benzoic acid? |
| A: CAS number of 3-fluoro-4-methoxy-5-nitro-benzoic acid is 577-39-9. |
| Q: What is the InChIKey of 3-fluoro-4-methoxy-5-nitro-benzoic acid? |
| A: InChIKey of 3-fluoro-4-methoxy-5-nitro-benzoic acid is FZVATVOZGBMDRQ-UHFFFAOYSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |