4-(2-nitrophenyl)butan-2-one
4-(2-nitrophenyl)butan-2-one structure
|
Common Name | 4-(2-nitrophenyl)butan-2-one | ||
|---|---|---|---|---|
| CAS Number | 58751-62-5 | Molecular Weight | 193.19900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(2-nitrophenyl)butan-2-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H11NO3 |
|---|---|
| Molecular Weight | 193.19900 |
| Exact Mass | 193.07400 |
| PSA | 62.89000 |
| LogP | 2.63960 |
| InChIKey | ZVNWPIWCTWRCHX-UHFFFAOYSA-N |
| SMILES | CC(=O)CCc1ccccc1[N+](=O)[O-] |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-Butanone,4-(2-nitrophenyl) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 4-(2-nitrophenyl)butan-2-one? |
| A: CAS number of 4-(2-nitrophenyl)butan-2-one is 58751-62-5. |
| Q: What is the LogP of 4-(2-nitrophenyl)butan-2-one? |
| A: LogP of 4-(2-nitrophenyl)butan-2-one is 2.63960. |
| Q: What is the SMILES notation of 4-(2-nitrophenyl)butan-2-one? |
| A: SMILES notation of 4-(2-nitrophenyl)butan-2-one is CC(=O)CCc1ccccc1[N+](=O)[O-]. |
| Q: What is the molecular formula of 4-(2-nitrophenyl)butan-2-one? |
| A: Molecular formula of 4-(2-nitrophenyl)butan-2-one is C10H11NO3. |
| Q: What is the InChIKey of 4-(2-nitrophenyl)butan-2-one? |
| A: InChIKey of 4-(2-nitrophenyl)butan-2-one is ZVNWPIWCTWRCHX-UHFFFAOYSA-N. |
| Q: What English synonyms does 4-(2-nitrophenyl)butan-2-one have? |
| A: English synonyms of 4-(2-nitrophenyl)butan-2-one: 2-Butanone,4-(2-nitrophenyl). |
| Q: What is the English name of 4-(2-nitrophenyl)butan-2-one? |
| A: The English name of 4-(2-nitrophenyl)butan-2-one is 4-(2-nitrophenyl)butan-2-one. |
| Q: What is the polar surface area (PSA) of 4-(2-nitrophenyl)butan-2-one? |
| A: Polar surface area (PSA) of 4-(2-nitrophenyl)butan-2-one is 62.89000. |
| Q: What is the molecular weight of 4-(2-nitrophenyl)butan-2-one? |
| A: Molecular weight of 4-(2-nitrophenyl)butan-2-one is 193.19900. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |