6-benzyl-5,6,7,8-tetrahydro-1,6-naphthyridin-2(1H)-one structure
|
Common Name | 6-benzyl-5,6,7,8-tetrahydro-1,6-naphthyridin-2(1H)-one | ||
|---|---|---|---|---|
| CAS Number | 601514-58-3 | Molecular Weight | 240.300 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 492.1±45.0 °C at 760 mmHg | |
| Molecular Formula | C15H16N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 251.4±28.7 °C | |
| Name | 6-Benzyl-5,6,7,8-tetrahydro-1,6-naphthyridin-2(1H)-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 492.1±45.0 °C at 760 mmHg |
| Molecular Formula | C15H16N2O |
| Molecular Weight | 240.300 |
| Flash Point | 251.4±28.7 °C |
| Exact Mass | 240.126266 |
| PSA | 36.10000 |
| LogP | 0.70 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.641 |
| InChIKey | BKSOOBNVMGYWAN-UHFFFAOYSA-N |
| SMILES | O=c1ccc2c([nH]1)CCN(Cc1ccccc1)C2 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
|
~47%
6-benzyl-5,6,7,... CAS#:601514-58-3 |
| Literature: PFIZER LIMITED Patent: WO2007/52124 A1, 2007 ; Location in patent: Page/Page column 15 ; WO 2007/052124 A1 |
|
~30%
6-benzyl-5,6,7,... CAS#:601514-58-3 |
| Literature: Pfizer Limited Patent: EP1595881 A1, 2005 ; Location in patent: Page/Page column 49 ; EP 1595881 A1 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-benzyl-1,5,7,8-tetrahydro-1,6-naphthyridin-2-one |
| 6-benzyl-5,6,7,8-tetrahydro-1,6-naphthyridin-2(1H)-one |