N-Ethyl-1,2-ethanediamine-ethane (1:2)
N-Ethyl-1,2-ethanediamine-ethane (1:2) structure
|
Common Name | N-Ethyl-1,2-ethanediamine-ethane (1:2) | ||
|---|---|---|---|---|
| CAS Number | 60984-63-6 | Molecular Weight | 148.290 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H24N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethane,N'-ethylethane-1,2-diamine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H24N2 |
|---|---|
| Molecular Weight | 148.290 |
| Exact Mass | 148.193954 |
| PSA | 38.05000 |
| LogP | 2.69820 |
| InChIKey | NVTGXPLADYDNKR-LZITWAFGSA-N |
| SMILES | NCCNCC1OC2OC3C(CO)OC(OC4C(CO)OC(OC5C(CO)OC(OC6C(CO)OC(OC7C(CO)OC(OC8C(CO)OC(OC1C(O)C2O)C(O)C8O)C(O)C7O)C(O)C6O)C(O)C5O)C(O)C4O)C(O)C3O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,2-Ethanediamine, N-ethyl-, compd. with ethane (1:2) |
| N-Ethyl-1,2-ethanediamine - ethane (1:2) |
| Mono-(6-ethanediamine-6-deoxy)-β-Cyclodextrin |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does ethane,N'-ethylethane-1,2-diamine have? |
| A: English synonyms of ethane,N'-ethylethane-1,2-diamine: 1,2-Ethanediamine, N-ethyl-, compd. with ethane (1:2), N-Ethyl-1,2-ethanediamine - ethane (1:2), Mono-(6-ethanediamine-6-deoxy)-β-Cyclodextrin. |
| Q: What is the InChIKey of ethane,N'-ethylethane-1,2-diamine? |
| A: InChIKey of ethane,N'-ethylethane-1,2-diamine is NVTGXPLADYDNKR-LZITWAFGSA-N. |
| Q: What is the SMILES notation of ethane,N'-ethylethane-1,2-diamine? |
| A: SMILES notation of ethane,N'-ethylethane-1,2-diamine is NCCNCC1OC2OC3C(CO)OC(OC4C(CO)OC(OC5C(CO)OC(OC6C(CO)OC(OC7C(CO)OC(OC8C(CO)OC(OC1C(O)C2O)C(O)C8O)C(O)C7O)C(O)C6O)C(O)C5O)C(O)C4O)C(O)C3O. |
| Q: What are the upstream materials of ethane,N'-ethylethane-1,2-diamine? |
| A: Related upstream materials(CAS) of ethane,N'-ethylethane-1,2-diamine: 67217-55-4;107-15-3;139143-55-8. |
| Q: What is the molecular weight of ethane,N'-ethylethane-1,2-diamine? |
| A: Molecular weight of ethane,N'-ethylethane-1,2-diamine is 148.290. |
| Q: What is the CAS number of ethane,N'-ethylethane-1,2-diamine? |
| A: CAS number of ethane,N'-ethylethane-1,2-diamine is 60984-63-6. |
| Q: What is the English name of ethane,N'-ethylethane-1,2-diamine? |
| A: The English name of ethane,N'-ethylethane-1,2-diamine is ethane,N'-ethylethane-1,2-diamine. |
| Q: What is the molecular formula of ethane,N'-ethylethane-1,2-diamine? |
| A: Molecular formula of ethane,N'-ethylethane-1,2-diamine is C8H24N2. |
| Q: What is the LogP of ethane,N'-ethylethane-1,2-diamine? |
| A: LogP of ethane,N'-ethylethane-1,2-diamine is 2.69820. |
| Q: What is the polar surface area (PSA) of ethane,N'-ethylethane-1,2-diamine? |
| A: Polar surface area (PSA) of ethane,N'-ethylethane-1,2-diamine is 38.05000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |