4,4''-p-Terphenyldicarboxaldehyde
4,4''-p-Terphenyldicarboxaldehyde structure
|
Common Name | 4,4''-p-Terphenyldicarboxaldehyde | ||
|---|---|---|---|---|
| CAS Number | 62940-38-9 | Molecular Weight | 286.32400 | |
| Density | 1.176±0.06 g/cm3(Predicted) | Boiling Point | 511.9±43.0℃(Predicted) | |
| Molecular Formula | C20H14O2 | Melting Point | 210-213 °C | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4,4''-p-Terphenyldicarboxaldehyde |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.176±0.06 g/cm3(Predicted) |
|---|---|
| Boiling Point | 511.9±43.0℃(Predicted) |
| Melting Point | 210-213 °C |
| Molecular Formula | C20H14O2 |
| Molecular Weight | 286.32400 |
| Exact Mass | 286.09900 |
| PSA | 34.14000 |
| LogP | 4.64560 |
| InChIKey | YGHMZQVOFVDADV-UHFFFAOYSA-N |
| SMILES | O=Cc1ccc(-c2ccc(-c3ccc(C=O)cc3)cc2)cc1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2912299000 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 8 | |
|---|---|
| DownStream 0 | |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2912299000 |
|---|---|
| Summary | 2912299000. other cyclic aldehydes without other oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| [4,4''-(1,1':4',1''-terphenyl)]dicarboxaldehyde |
| [1,1':4',1''-terphenyl]-4,4''-dicarbaldehyde |
| [1,1':4',1''-Terphenyl]-4,4''-dicarboxaldehyde |
| terphenyl-4,4''-dicarbaldehyde |
| 4,4"-p-terphenyldicarboxaldehyde |
| 1,4-di-(p-formylphenyl)benzene |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 4,4''-p-Terphenyldicarboxaldehyde have? |
| A: English synonyms of 4,4''-p-Terphenyldicarboxaldehyde: [4,4''-(1,1':4',1''-terphenyl)]dicarboxaldehyde, [1,1':4',1''-terphenyl]-4,4''-dicarbaldehyde, [1,1':4',1''-Terphenyl]-4,4''-dicarboxaldehyde, terphenyl-4,4''-dicarbaldehyde, 4,4"-p-terphenyldicarboxaldehyde, 1,4-di-(p-formylphenyl)benzene. |
| Q: What is the boiling point of 4,4''-p-Terphenyldicarboxaldehyde? |
| A: Boiling point of 4,4''-p-Terphenyldicarboxaldehyde is 511.9±43.0℃(Predicted). |
| Q: What is the CAS number of 4,4''-p-Terphenyldicarboxaldehyde? |
| A: CAS number of 4,4''-p-Terphenyldicarboxaldehyde is 62940-38-9. |
| Q: What is the melting point of 4,4''-p-Terphenyldicarboxaldehyde? |
| A: Melting point of 4,4''-p-Terphenyldicarboxaldehyde is 210-213 °C. |
| Q: What is the molecular weight of 4,4''-p-Terphenyldicarboxaldehyde? |
| A: Molecular weight of 4,4''-p-Terphenyldicarboxaldehyde is 286.32400. |
| Q: What is the LogP of 4,4''-p-Terphenyldicarboxaldehyde? |
| A: LogP of 4,4''-p-Terphenyldicarboxaldehyde is 4.64560. |
| Q: What is the InChIKey of 4,4''-p-Terphenyldicarboxaldehyde? |
| A: InChIKey of 4,4''-p-Terphenyldicarboxaldehyde is YGHMZQVOFVDADV-UHFFFAOYSA-N. |
| Q: What are the upstream materials of 4,4''-p-Terphenyldicarboxaldehyde? |
| A: Related upstream materials(CAS) of 4,4''-p-Terphenyldicarboxaldehyde: 106-37-6;87199-17-5;4612-26-4;1122-91-4;41425-57-4;92-94-4;24856-58-4;97295-31-3. |
| Q: What is the polar surface area (PSA) of 4,4''-p-Terphenyldicarboxaldehyde? |
| A: Polar surface area (PSA) of 4,4''-p-Terphenyldicarboxaldehyde is 34.14000. |
| Q: What is the SMILES notation of 4,4''-p-Terphenyldicarboxaldehyde? |
| A: SMILES notation of 4,4''-p-Terphenyldicarboxaldehyde is O=Cc1ccc(-c2ccc(-c3ccc(C=O)cc3)cc2)cc1. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |