4-Fluoro-1-(triisopropylsilyl)-1H-pyrrolo[2,3-b]pyridine structure
|
Common Name | 4-Fluoro-1-(triisopropylsilyl)-1H-pyrrolo[2,3-b]pyridine | ||
|---|---|---|---|---|
| CAS Number | 640735-25-7 | Molecular Weight | 292.46700 | |
| Density | 1.02g/cm3 | Boiling Point | 305.2ºC at 760 mmHg | |
| Molecular Formula | C16H25FN2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 138.4ºC | |
Summary: 4-Fluoro-1-(triisopropylsilyl)-1H-pyrrolo[2,3-b]pyridine (common name: 4-Fluoro-1-(triisopropylsilyl)-1H-pyrrolo[2,3-b]pyridine) is a colorless oily liquid, with CAS number 640735-25-7, molecular formula C16H25FN2Si, and molecular weight 292.46700. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (4-fluoropyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)silane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.02g/cm3 |
|---|---|
| Boiling Point | 305.2ºC at 760 mmHg |
| Molecular Formula | C16H25FN2Si |
| Molecular Weight | 292.46700 |
| Flash Point | 138.4ºC |
| Exact Mass | 292.17700 |
| PSA | 17.82000 |
| LogP | 5.19900 |
| Index of Refraction | 1.514 |
| InChIKey | YESANHMKGXGZLQ-UHFFFAOYSA-N |
| SMILES | CC(C)[Si](C(C)C)(C(C)C)n1ccc2c(F)ccnc21 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 7 | |
|---|---|
| DownStream 5 | |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| PYRROLO[2,3-B]PYRIDINE,4-FLUORO-1-[TRIS(1-METHYLETHYL)SILYL] |
| N-triisopropylsilyl-4-fluoro-7-azaindole |
| 1H-PYRROLO[2,3-B]PYRIDINE,4-FLUORO-1-[TRIS(1-METHYLETHYL)SILYL] |
| 4-fluoro-1-(triisopropylsilyl)-1H-pyrrolo[2,3-b]pyridine |
| 4-FLUORO-1-(TRIISOPROPYLSILANYL)-7-AZAINDOLE |
| 4-fluoro-1-triisopropylsilanyl-1H-pyrrolo[2,3-b]pyridine |
| 1-triisopropyl-4-fluoro-7-azaindole |
| 4-fluoro-1-[tris(propan-2-yl)silyl]-1H-pyrrolo[2,3-b]pyridine |
| 4-FLUORO-1-[TRIS(1-METHYLETHYL)SILYL]-1H-PYRROLO[2,3-B]PYRIDINE |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of (4-fluoropyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)silane? |
| A: LogP of (4-fluoropyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)silane is 5.19900. |
| Q: What is the InChIKey of (4-fluoropyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)silane? |
| A: InChIKey of (4-fluoropyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)silane is YESANHMKGXGZLQ-UHFFFAOYSA-N. |
| Q: What is the boiling point of (4-fluoropyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)silane? |
| A: Boiling point of (4-fluoropyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)silane is 305.2ºC at 760 mmHg. |
| Q: What are the downstream products of (4-fluoropyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)silane? |
| A: Related downstream products(CAS) of (4-fluoropyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)silane: 640735-23-5;1172068-33-5;1172067-95-6;685513-93-3;577768-59-3. |
| Q: What are the upstream materials of (4-fluoropyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)silane? |
| A: Related upstream materials(CAS) of (4-fluoropyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)silane: 640735-24-6;920501-58-2;13154-24-0;348640-06-2;55052-24-9;319474-34-5;55052-28-3. |
| Q: What is the polar surface area (PSA) of (4-fluoropyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)silane? |
| A: Polar surface area (PSA) of (4-fluoropyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)silane is 17.82000. |
| Q: What is the SMILES notation of (4-fluoropyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)silane? |
| A: SMILES notation of (4-fluoropyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)silane is CC(C)[Si](C(C)C)(C(C)C)n1ccc2c(F)ccnc21. |
| Q: What is the molecular formula of (4-fluoropyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)silane? |
| A: Molecular formula of (4-fluoropyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)silane is C16H25FN2Si. |
| Q: What is the CAS number of (4-fluoropyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)silane? |
| A: CAS number of (4-fluoropyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)silane is 640735-25-7. |
| Q: What is the molecular weight of (4-fluoropyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)silane? |
| A: Molecular weight of (4-fluoropyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)silane is 292.46700. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |