Dimethyl 4,5-dihydroxyphthalate
Dimethyl 4,5-dihydroxyphthalate structure
|
Common Name | Dimethyl 4,5-dihydroxyphthalate | ||
|---|---|---|---|---|
| CAS Number | 66323-03-3 | Molecular Weight | 226.183 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 412.1±40.0 °C at 760 mmHg | |
| Molecular Formula | C10H10O6 | Melting Point | 141.5-142.5°C | |
| MSDS | N/A | Flash Point | 164.9±20.8 °C | |
Summary: Dimethyl 4,5-dihydroxyphthalate (4,5-bis(hydroxy)phthalic acid dimethyl ester, CAS: 66323-03-3, molecular formula: C10H10O6, molecular weight: 226.183) is for research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4,5-bis(hydroxy)phthalic acid dimethyl ester |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 412.1±40.0 °C at 760 mmHg |
| Melting Point | 141.5-142.5°C |
| Molecular Formula | C10H10O6 |
| Molecular Weight | 226.183 |
| Flash Point | 164.9±20.8 °C |
| Exact Mass | 226.047745 |
| PSA | 93.06000 |
| LogP | 1.97 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.575 |
| InChIKey | FXPCZDQRACWUBW-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(O)c(O)cc1C(=O)OC |
| Storage condition | 2-8°C |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi |
|---|
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:17078-61-4
CAS#:577-68-4This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Dimethyl 4,5-dihydroxyphthalate |
| 1,2-Benzenedicarboxylic acid, 4,5-dihydroxy-, dimethyl ester |
| 4,5-dihydroxy-phthalic acid dimethyl ester |
| 4,5-dihydroxyphthalate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 4,5-bis(hydroxy)phthalic acid dimethyl ester? |
| A: Molecular formula of 4,5-bis(hydroxy)phthalic acid dimethyl ester is C10H10O6. |
| Q: What is the SMILES notation of 4,5-bis(hydroxy)phthalic acid dimethyl ester? |
| A: SMILES notation of 4,5-bis(hydroxy)phthalic acid dimethyl ester is COC(=O)c1cc(O)c(O)cc1C(=O)OC. |
| Q: What English synonyms does 4,5-bis(hydroxy)phthalic acid dimethyl ester have? |
| A: English synonyms of 4,5-bis(hydroxy)phthalic acid dimethyl ester: Dimethyl 4,5-dihydroxyphthalate, 1,2-Benzenedicarboxylic acid, 4,5-dihydroxy-, dimethyl ester, 4,5-dihydroxy-phthalic acid dimethyl ester, 4,5-dihydroxyphthalate. |
| Q: What is the polar surface area (PSA) of 4,5-bis(hydroxy)phthalic acid dimethyl ester? |
| A: Polar surface area (PSA) of 4,5-bis(hydroxy)phthalic acid dimethyl ester is 93.06000. |
| Q: What is the English name of 4,5-bis(hydroxy)phthalic acid dimethyl ester? |
| A: The English name of 4,5-bis(hydroxy)phthalic acid dimethyl ester is 4,5-bis(hydroxy)phthalic acid dimethyl ester. |
| Q: What is the LogP of 4,5-bis(hydroxy)phthalic acid dimethyl ester? |
| A: LogP of 4,5-bis(hydroxy)phthalic acid dimethyl ester is 1.97. |
| Q: What is the melting point of 4,5-bis(hydroxy)phthalic acid dimethyl ester? |
| A: Melting point of 4,5-bis(hydroxy)phthalic acid dimethyl ester is 141.5-142.5°C. |
| Q: What is the InChIKey of 4,5-bis(hydroxy)phthalic acid dimethyl ester? |
| A: InChIKey of 4,5-bis(hydroxy)phthalic acid dimethyl ester is FXPCZDQRACWUBW-UHFFFAOYSA-N. |
| Q: What is the boiling point of 4,5-bis(hydroxy)phthalic acid dimethyl ester? |
| A: Boiling point of 4,5-bis(hydroxy)phthalic acid dimethyl ester is 412.1±40.0 °C at 760 mmHg. |
| Q: What is the molecular weight of 4,5-bis(hydroxy)phthalic acid dimethyl ester? |
| A: Molecular weight of 4,5-bis(hydroxy)phthalic acid dimethyl ester is 226.183. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |