2-Amino-9-[(2R,4S,5S)-4-amino-5-(hydroxymethyl)oxolan-2-yl]-3H-purin-6-one structure
|
Common Name | 2-Amino-9-[(2R,4S,5S)-4-amino-5-(hydroxymethyl)oxolan-2-yl]-3H-purin-6-one | ||
|---|---|---|---|---|
| CAS Number | 66323-49-7 | Molecular Weight | 266.25700 | |
| Density | 2.08g/cm3 | Boiling Point | 662.4ºC at 760mmHg | |
| Molecular Formula | C10H14N6O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 354.4ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Amino-9-[(2R,4S,5S)-4-amino-5-(hydroxymethyl)oxolan-2-yl]-3H-purin-6-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 2.08g/cm3 |
|---|---|
| Boiling Point | 662.4ºC at 760mmHg |
| Molecular Formula | C10H14N6O3 |
| Molecular Weight | 266.25700 |
| Flash Point | 354.4ºC |
| Exact Mass | 266.11300 |
| PSA | 145.07000 |
| Appearance of Characters | Powder | Off-white to Yellow |
| Index of Refraction | 1.935 |
| InChIKey | HOQBPAWPBCAUGA-KVQBGUIXSA-N |
| SMILES | Nc1nc2c(ncn2C2CC(N)C(CO)O2)c(=O)[nH]1 |
| Water Solubility | Soluble in water (50 mg/ml). |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~20%
2-Amino-9-[(2R,... CAS#:66323-49-7 |
| Literature: Zaitseva; Kvasyuk; Vaaks; Barai; Bokut; Zinchenko; Mikhailopulo Nucleosides and Nucleotides, 1994 , vol. 13, # 1-3 p. 819 - 834 |
|
~%
2-Amino-9-[(2R,... CAS#:66323-49-7 |
| Literature: Nucleosides and Nucleotides, , vol. 13, # 1-3 p. 819 - 834 |
|
~%
2-Amino-9-[(2R,... CAS#:66323-49-7 |
| Literature: Nucleosides and Nucleotides, , vol. 13, # 1-3 p. 819 - 834 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3'-amino-2',3'-dideoxyaguanosine |
| 3'-NH2-ddG |
| HG1064 |
| 3'-Amino-2',3'-dideoxyguanosine |
| Guanosine,3'-amino-2',3'-dideoxy |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2-Amino-9-[(2R,4S,5S)-4-amino-5-(hydroxymethyl)oxolan-2-yl]-3H-purin-6-one? |
| A: Molecular formula of 2-Amino-9-[(2R,4S,5S)-4-amino-5-(hydroxymethyl)oxolan-2-yl]-3H-purin-6-one is C10H14N6O3. |
| Q: What is the boiling point of 2-Amino-9-[(2R,4S,5S)-4-amino-5-(hydroxymethyl)oxolan-2-yl]-3H-purin-6-one? |
| A: Boiling point of 2-Amino-9-[(2R,4S,5S)-4-amino-5-(hydroxymethyl)oxolan-2-yl]-3H-purin-6-one is 662.4ºC at 760mmHg. |
| Q: What is the InChIKey of 2-Amino-9-[(2R,4S,5S)-4-amino-5-(hydroxymethyl)oxolan-2-yl]-3H-purin-6-one? |
| A: InChIKey of 2-Amino-9-[(2R,4S,5S)-4-amino-5-(hydroxymethyl)oxolan-2-yl]-3H-purin-6-one is HOQBPAWPBCAUGA-KVQBGUIXSA-N. |
| Q: What is the English name of 2-Amino-9-[(2R,4S,5S)-4-amino-5-(hydroxymethyl)oxolan-2-yl]-3H-purin-6-one? |
| A: The English name of 2-Amino-9-[(2R,4S,5S)-4-amino-5-(hydroxymethyl)oxolan-2-yl]-3H-purin-6-one is 2-Amino-9-[(2R,4S,5S)-4-amino-5-(hydroxymethyl)oxolan-2-yl]-3H-purin-6-one. |
| Q: What is the CAS number of 2-Amino-9-[(2R,4S,5S)-4-amino-5-(hydroxymethyl)oxolan-2-yl]-3H-purin-6-one? |
| A: CAS number of 2-Amino-9-[(2R,4S,5S)-4-amino-5-(hydroxymethyl)oxolan-2-yl]-3H-purin-6-one is 66323-49-7. |
| Q: What is the SMILES notation of 2-Amino-9-[(2R,4S,5S)-4-amino-5-(hydroxymethyl)oxolan-2-yl]-3H-purin-6-one? |
| A: SMILES notation of 2-Amino-9-[(2R,4S,5S)-4-amino-5-(hydroxymethyl)oxolan-2-yl]-3H-purin-6-one is Nc1nc2c(ncn2C2CC(N)C(CO)O2)c(=O)[nH]1. |
| Q: How is the water solubility of 2-Amino-9-[(2R,4S,5S)-4-amino-5-(hydroxymethyl)oxolan-2-yl]-3H-purin-6-one? |
| A: Water solubility of 2-Amino-9-[(2R,4S,5S)-4-amino-5-(hydroxymethyl)oxolan-2-yl]-3H-purin-6-one: Soluble in water (50 mg/ml). |
| Q: What is the physical appearance of 2-Amino-9-[(2R,4S,5S)-4-amino-5-(hydroxymethyl)oxolan-2-yl]-3H-purin-6-one? |
| A: 2-Amino-9-[(2R,4S,5S)-4-amino-5-(hydroxymethyl)oxolan-2-yl]-3H-purin-6-one appears as Powder | Off-white to Yellow. |
| Q: What is the molecular weight of 2-Amino-9-[(2R,4S,5S)-4-amino-5-(hydroxymethyl)oxolan-2-yl]-3H-purin-6-one? |
| A: Molecular weight of 2-Amino-9-[(2R,4S,5S)-4-amino-5-(hydroxymethyl)oxolan-2-yl]-3H-purin-6-one is 266.25700. |
| Q: What English synonyms does 2-Amino-9-[(2R,4S,5S)-4-amino-5-(hydroxymethyl)oxolan-2-yl]-3H-purin-6-one have? |
| A: English synonyms of 2-Amino-9-[(2R,4S,5S)-4-amino-5-(hydroxymethyl)oxolan-2-yl]-3H-purin-6-one: 3'-amino-2',3'-dideoxyaguanosine, 3'-NH2-ddG, HG1064, 3'-Amino-2',3'-dideoxyguanosine, Guanosine,3'-amino-2',3'-dideoxy. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |