5-(Benzyloxy)-1H-indole-2-carboxylic acid
5-(Benzyloxy)-1H-indole-2-carboxylic acid structure
|
Common Name | 5-(Benzyloxy)-1H-indole-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 6640-09-1 | Molecular Weight | 267.279 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 531.1±35.0 °C at 760 mmHg | |
| Molecular Formula | C16H13NO3 | Melting Point | 192 °C | |
| MSDS | N/A | Flash Point | 275.0±25.9 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-(Benzyloxy)-1H-indole-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 531.1±35.0 °C at 760 mmHg |
| Melting Point | 192 °C |
| Molecular Formula | C16H13NO3 |
| Molecular Weight | 267.279 |
| Flash Point | 275.0±25.9 °C |
| Exact Mass | 267.089539 |
| PSA | 62.32000 |
| LogP | 3.88 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.696 |
| InChIKey | MVCLSAMNMAWXFQ-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc2cc(OCc3ccccc3)ccc2[nH]1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi:Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| HS Code | 2933990090 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 9 | |
|---|---|
| DownStream 10 | |
CAS#:55581-41-4
CAS#:37033-95-7
CAS#:21598-06-1
CAS#:100-39-0
CAS#:1700-37-4
CAS#:100-83-4
CAS#:22424-59-5
CAS#:2581-34-2
CAS#:22424-58-4
CAS#:50-67-9
CAS#:4382-53-0
CAS#:20776-45-8
CAS#:1953-54-4
CAS#:6953-22-6
CAS#:1215-59-4
CAS#:1453-97-0
CAS#:2436-15-9
CAS#:51991-39-0This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| EINECS 229-652-6 |
| MFCD00047165 |
| 5-(Benzyloxy)-1H-indole-2-carboxylic acid |
| 5-phenylmethoxy-1H-indole-2-carboxylic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the safety information for 5-(Benzyloxy)-1H-indole-2-carboxylic acid? |
| A: Safety information for 5-(Benzyloxy)-1H-indole-2-carboxylic acid: S26-S36. |
| Q: What is the English name of 5-(Benzyloxy)-1H-indole-2-carboxylic acid? |
| A: The English name of 5-(Benzyloxy)-1H-indole-2-carboxylic acid is 5-(Benzyloxy)-1H-indole-2-carboxylic acid. |
| Q: What is the LogP of 5-(Benzyloxy)-1H-indole-2-carboxylic acid? |
| A: LogP of 5-(Benzyloxy)-1H-indole-2-carboxylic acid is 3.88. |
| Q: What is the CAS number of 5-(Benzyloxy)-1H-indole-2-carboxylic acid? |
| A: CAS number of 5-(Benzyloxy)-1H-indole-2-carboxylic acid is 6640-09-1. |
| Q: What is the melting point of 5-(Benzyloxy)-1H-indole-2-carboxylic acid? |
| A: Melting point of 5-(Benzyloxy)-1H-indole-2-carboxylic acid is 192 °C. |
| Q: What is the boiling point of 5-(Benzyloxy)-1H-indole-2-carboxylic acid? |
| A: Boiling point of 5-(Benzyloxy)-1H-indole-2-carboxylic acid is 531.1±35.0 °C at 760 mmHg. |
| Q: What English synonyms does 5-(Benzyloxy)-1H-indole-2-carboxylic acid have? |
| A: English synonyms of 5-(Benzyloxy)-1H-indole-2-carboxylic acid: EINECS 229-652-6, MFCD00047165, 5-(Benzyloxy)-1H-indole-2-carboxylic acid, 5-phenylmethoxy-1H-indole-2-carboxylic acid. |
| Q: What is the molecular weight of 5-(Benzyloxy)-1H-indole-2-carboxylic acid? |
| A: Molecular weight of 5-(Benzyloxy)-1H-indole-2-carboxylic acid is 267.279. |
| Q: What are the upstream materials of 5-(Benzyloxy)-1H-indole-2-carboxylic acid? |
| A: Related upstream materials(CAS) of 5-(Benzyloxy)-1H-indole-2-carboxylic acid: 55581-41-4;37033-95-7;21598-06-1;100-39-0;1700-37-4;100-83-4;22424-59-5;2581-34-2;22424-58-4. |
| Q: What is the molecular formula of 5-(Benzyloxy)-1H-indole-2-carboxylic acid? |
| A: Molecular formula of 5-(Benzyloxy)-1H-indole-2-carboxylic acid is C16H13NO3. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |