4, 4, 5, 5, 6, 6, 6-Heptafluorohexan-1-ol
4, 4, 5, 5, 6, 6, 6-Heptafluorohexan-1-ol structure
|
Common Name | 4, 4, 5, 5, 6, 6, 6-Heptafluorohexan-1-ol | ||
|---|---|---|---|---|
| CAS Number | 679-02-7 | Molecular Weight | 228.10800 | |
| Density | 1.396g/cm3 | Boiling Point | 140ºC | |
| Molecular Formula | C6H7F7O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | >110ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4,4,5,5,6,6,6-Heptafluorohexan-1-ol |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.396g/cm3 |
|---|---|
| Boiling Point | 140ºC |
| Molecular Formula | C6H7F7O |
| Molecular Weight | 228.10800 |
| Flash Point | >110ºC |
| Exact Mass | 228.03900 |
| PSA | 20.23000 |
| LogP | 2.59180 |
| Index of Refraction | 1.32 |
| InChIKey | VACKBPFJJWRSAO-UHFFFAOYSA-N |
| SMILES | OCCCC(F)(F)C(F)(F)C(F)(F)F |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:25600-64-0
CAS#:3108-05-2
CAS#:356-02-5This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| MFCD00077554 |
| 4,4,5,5,6,6,6-heptafluorohexan-1-ol |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 4,4,5,5,6,6,6-Heptafluorohexan-1-ol? |
| A: LogP of 4,4,5,5,6,6,6-Heptafluorohexan-1-ol is 2.59180. |
| Q: What is the SMILES notation of 4,4,5,5,6,6,6-Heptafluorohexan-1-ol? |
| A: SMILES notation of 4,4,5,5,6,6,6-Heptafluorohexan-1-ol is OCCCC(F)(F)C(F)(F)C(F)(F)F. |
| Q: What are the upstream materials of 4,4,5,5,6,6,6-Heptafluorohexan-1-ol? |
| A: Related upstream materials(CAS) of 4,4,5,5,6,6,6-Heptafluorohexan-1-ol: 25600-64-0;3108-05-2. |
| Q: What is the CAS number of 4,4,5,5,6,6,6-Heptafluorohexan-1-ol? |
| A: CAS number of 4,4,5,5,6,6,6-Heptafluorohexan-1-ol is 679-02-7. |
| Q: What are the downstream products of 4,4,5,5,6,6,6-Heptafluorohexan-1-ol? |
| A: Related downstream products(CAS) of 4,4,5,5,6,6,6-Heptafluorohexan-1-ol: 356-02-5. |
| Q: What is the polar surface area (PSA) of 4,4,5,5,6,6,6-Heptafluorohexan-1-ol? |
| A: Polar surface area (PSA) of 4,4,5,5,6,6,6-Heptafluorohexan-1-ol is 20.23000. |
| Q: What is the boiling point of 4,4,5,5,6,6,6-Heptafluorohexan-1-ol? |
| A: Boiling point of 4,4,5,5,6,6,6-Heptafluorohexan-1-ol is 140ºC. |
| Q: What is the molecular weight of 4,4,5,5,6,6,6-Heptafluorohexan-1-ol? |
| A: Molecular weight of 4,4,5,5,6,6,6-Heptafluorohexan-1-ol is 228.10800. |
| Q: What is the safety information for 4,4,5,5,6,6,6-Heptafluorohexan-1-ol? |
| A: Safety information for 4,4,5,5,6,6,6-Heptafluorohexan-1-ol: 26-36. |
| Q: What is the InChIKey of 4,4,5,5,6,6,6-Heptafluorohexan-1-ol? |
| A: InChIKey of 4,4,5,5,6,6,6-Heptafluorohexan-1-ol is VACKBPFJJWRSAO-UHFFFAOYSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |