METHYL 3-OXO-2,3-DIHYDRO-1H-INDENE-5-CARBOXYLATE
METHYL 3-OXO-2,3-DIHYDRO-1H-INDENE-5-CARBOXYLATE structure
|
Common Name | METHYL 3-OXO-2,3-DIHYDRO-1H-INDENE-5-CARBOXYLATE | ||
|---|---|---|---|---|
| CAS Number | 68634-03-7 | Molecular Weight | 190.19500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H10O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl 3-oxo-1,2-dihydroindene-5-carboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H10O3 |
|---|---|
| Molecular Weight | 190.19500 |
| Exact Mass | 190.06300 |
| PSA | 43.37000 |
| LogP | 1.60210 |
| InChIKey | YDOOCAKREHMAEB-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc2c(c1)C(=O)CC2 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918300090 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 8 | |
|---|---|
| DownStream 0 | |
CAS#:67-56-1
CAS#:60031-08-5
CAS#:86031-43-8
CAS#:65898-38-6
CAS#:496-11-7
CAS#:4228-10-8
CAS#:858124-35-3
CAS#:1095432-84-0This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Methyl 3-oxo-2,3-dihydro-1H-indene-5-carboxylate |
| 1H-Indene-5-carboxylic acid,2,3-dihydro-3-oxo-,methyl ester |
| 3-oxo-indan-5-carboxylic acid methyl ester |
| methyl 1-oxoindan-6-carboxylate |
| 6-methoxycarbonyl-1-indanone |
| Methyl indan-1-one-6-carboxylate |
| Methyl 1-oxo-6-indancarboncarboxylat |
| 6-carbomethoxyindan-1-one |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of methyl 3-oxo-1,2-dihydroindene-5-carboxylate? |
| A: Polar surface area (PSA) of methyl 3-oxo-1,2-dihydroindene-5-carboxylate is 43.37000. |
| Q: What is the LogP of methyl 3-oxo-1,2-dihydroindene-5-carboxylate? |
| A: LogP of methyl 3-oxo-1,2-dihydroindene-5-carboxylate is 1.60210. |
| Q: What is the English name of methyl 3-oxo-1,2-dihydroindene-5-carboxylate? |
| A: The English name of methyl 3-oxo-1,2-dihydroindene-5-carboxylate is methyl 3-oxo-1,2-dihydroindene-5-carboxylate. |
| Q: What are the upstream materials of methyl 3-oxo-1,2-dihydroindene-5-carboxylate? |
| A: Related upstream materials(CAS) of methyl 3-oxo-1,2-dihydroindene-5-carboxylate: 67-56-1;60031-08-5;86031-43-8;65898-38-6;496-11-7;4228-10-8;858124-35-3;1095432-84-0. |
| Q: What is the SMILES notation of methyl 3-oxo-1,2-dihydroindene-5-carboxylate? |
| A: SMILES notation of methyl 3-oxo-1,2-dihydroindene-5-carboxylate is COC(=O)c1ccc2c(c1)C(=O)CC2. |
| Q: What English synonyms does methyl 3-oxo-1,2-dihydroindene-5-carboxylate have? |
| A: English synonyms of methyl 3-oxo-1,2-dihydroindene-5-carboxylate: Methyl 3-oxo-2,3-dihydro-1H-indene-5-carboxylate, 1H-Indene-5-carboxylic acid,2,3-dihydro-3-oxo-,methyl ester, 3-oxo-indan-5-carboxylic acid methyl ester, methyl 1-oxoindan-6-carboxylate, 6-methoxycarbonyl-1-indanone, Methyl indan-1-one-6-carboxylate, Methyl 1-oxo-6-indancarboncarboxylat, 6-carbomethoxyindan-1-one. |
| Q: What is the molecular weight of methyl 3-oxo-1,2-dihydroindene-5-carboxylate? |
| A: Molecular weight of methyl 3-oxo-1,2-dihydroindene-5-carboxylate is 190.19500. |
| Q: What is the InChIKey of methyl 3-oxo-1,2-dihydroindene-5-carboxylate? |
| A: InChIKey of methyl 3-oxo-1,2-dihydroindene-5-carboxylate is YDOOCAKREHMAEB-UHFFFAOYSA-N. |
| Q: What is the molecular formula of methyl 3-oxo-1,2-dihydroindene-5-carboxylate? |
| A: Molecular formula of methyl 3-oxo-1,2-dihydroindene-5-carboxylate is C11H10O3. |
| Q: What is the CAS number of methyl 3-oxo-1,2-dihydroindene-5-carboxylate? |
| A: CAS number of methyl 3-oxo-1,2-dihydroindene-5-carboxylate is 68634-03-7. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |