3,8-Dibromo-6-nitroquinoline
3,8-Dibromo-6-nitroquinoline structure
|
Common Name | 3,8-Dibromo-6-nitroquinoline | ||
|---|---|---|---|---|
| CAS Number | 696611-46-8 | Molecular Weight | 331.948 | |
| Density | 2.1±0.1 g/cm3 | Boiling Point | 409.2±40.0 °C at 760 mmHg | |
| Molecular Formula | C9H4Br2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.3±27.3 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,8-dibromo-6-nitroquinoline |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 2.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 409.2±40.0 °C at 760 mmHg |
| Molecular Formula | C9H4Br2N2O2 |
| Molecular Weight | 331.948 |
| Flash Point | 201.3±27.3 °C |
| Exact Mass | 329.863922 |
| PSA | 58.71000 |
| LogP | 3.01 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.728 |
| InChIKey | IPAXEFNOGMMLJV-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(Br)c2ncc(Br)cc2c1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933499090 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:7101-96-4This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3,8-Dibromo-6-nitroquinoline |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 3,8-dibromo-6-nitroquinoline? |
| A: Molecular formula of 3,8-dibromo-6-nitroquinoline is C9H4Br2N2O2. |
| Q: What is the InChIKey of 3,8-dibromo-6-nitroquinoline? |
| A: InChIKey of 3,8-dibromo-6-nitroquinoline is IPAXEFNOGMMLJV-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 3,8-dibromo-6-nitroquinoline? |
| A: Molecular weight of 3,8-dibromo-6-nitroquinoline is 331.948. |
| Q: What is the LogP of 3,8-dibromo-6-nitroquinoline? |
| A: LogP of 3,8-dibromo-6-nitroquinoline is 3.01. |
| Q: What is the boiling point of 3,8-dibromo-6-nitroquinoline? |
| A: Boiling point of 3,8-dibromo-6-nitroquinoline is 409.2±40.0 °C at 760 mmHg. |
| Q: What is the polar surface area (PSA) of 3,8-dibromo-6-nitroquinoline? |
| A: Polar surface area (PSA) of 3,8-dibromo-6-nitroquinoline is 58.71000. |
| Q: What is the SMILES notation of 3,8-dibromo-6-nitroquinoline? |
| A: SMILES notation of 3,8-dibromo-6-nitroquinoline is O=[N+]([O-])c1cc(Br)c2ncc(Br)cc2c1. |
| Q: What is the English name of 3,8-dibromo-6-nitroquinoline? |
| A: The English name of 3,8-dibromo-6-nitroquinoline is 3,8-dibromo-6-nitroquinoline. |
| Q: What are the downstream products of 3,8-dibromo-6-nitroquinoline? |
| A: Related downstream products(CAS) of 3,8-dibromo-6-nitroquinoline: 7101-96-4. |
| Q: What English synonyms does 3,8-dibromo-6-nitroquinoline have? |
| A: English synonyms of 3,8-dibromo-6-nitroquinoline: 3,8-Dibromo-6-nitroquinoline. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |