(2-Amino-5-(trifluoromethyl)phenyl)(phenyl)methanone
(2-Amino-5-(trifluoromethyl)phenyl)(phenyl)methanone structure
|
Common Name | (2-Amino-5-(trifluoromethyl)phenyl)(phenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 732-34-3 | Molecular Weight | 265.23100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H10F3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [2-amino-5-(trifluoromethyl)phenyl]-phenylmethanone |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H10F3NO |
|---|---|
| Molecular Weight | 265.23100 |
| Exact Mass | 265.07100 |
| PSA | 43.09000 |
| LogP | 4.09980 |
| InChIKey | NRMOBHGSHDKJLW-UHFFFAOYSA-N |
| SMILES | Nc1ccc(C(F)(F)F)cc1C(=O)c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 6 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-Amino-5-trifluormethyl-benzophenon |
| 2-Amino-4-trifluormethyl-benzophenon |
| 2-amino-5-trifluoromethylbenzophenone |
| 5-Trifluormethyl-2-amino-benzophenon |
| Methanone,[2-amino-5-(trifluoromethyl)phenyl]phenyl |
| (2-amino-5-(trifluoromethyl)phenyl)(phenyl)methanone |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of [2-amino-5-(trifluoromethyl)phenyl]-phenylmethanone? |
| A: Polar surface area (PSA) of [2-amino-5-(trifluoromethyl)phenyl]-phenylmethanone is 43.09000. |
| Q: What is the SMILES notation of [2-amino-5-(trifluoromethyl)phenyl]-phenylmethanone? |
| A: SMILES notation of [2-amino-5-(trifluoromethyl)phenyl]-phenylmethanone is Nc1ccc(C(F)(F)F)cc1C(=O)c1ccccc1. |
| Q: What is the InChIKey of [2-amino-5-(trifluoromethyl)phenyl]-phenylmethanone? |
| A: InChIKey of [2-amino-5-(trifluoromethyl)phenyl]-phenylmethanone is NRMOBHGSHDKJLW-UHFFFAOYSA-N. |
| Q: What is the CAS number of [2-amino-5-(trifluoromethyl)phenyl]-phenylmethanone? |
| A: CAS number of [2-amino-5-(trifluoromethyl)phenyl]-phenylmethanone is 732-34-3. |
| Q: What is the English name of [2-amino-5-(trifluoromethyl)phenyl]-phenylmethanone? |
| A: The English name of [2-amino-5-(trifluoromethyl)phenyl]-phenylmethanone is [2-amino-5-(trifluoromethyl)phenyl]-phenylmethanone. |
| Q: What is the LogP of [2-amino-5-(trifluoromethyl)phenyl]-phenylmethanone? |
| A: LogP of [2-amino-5-(trifluoromethyl)phenyl]-phenylmethanone is 4.09980. |
| Q: What is the molecular formula of [2-amino-5-(trifluoromethyl)phenyl]-phenylmethanone? |
| A: Molecular formula of [2-amino-5-(trifluoromethyl)phenyl]-phenylmethanone is C14H10F3NO. |
| Q: What is the molecular weight of [2-amino-5-(trifluoromethyl)phenyl]-phenylmethanone? |
| A: Molecular weight of [2-amino-5-(trifluoromethyl)phenyl]-phenylmethanone is 265.23100. |
| Q: What English synonyms does [2-amino-5-(trifluoromethyl)phenyl]-phenylmethanone have? |
| A: English synonyms of [2-amino-5-(trifluoromethyl)phenyl]-phenylmethanone: 2-Amino-5-trifluormethyl-benzophenon, 2-Amino-4-trifluormethyl-benzophenon, 2-amino-5-trifluoromethylbenzophenone, 5-Trifluormethyl-2-amino-benzophenon, Methanone,[2-amino-5-(trifluoromethyl)phenyl]phenyl, (2-amino-5-(trifluoromethyl)phenyl)(phenyl)methanone. |
| Q: What are the upstream materials of [2-amino-5-(trifluoromethyl)phenyl]-phenylmethanone? |
| A: Related upstream materials(CAS) of [2-amino-5-(trifluoromethyl)phenyl]-phenylmethanone: 789-96-8;93-58-3;141940-37-6;328-87-0;121-50-6;2358-09-0. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |