2-Methyl-2-propanyl (2R,4R)-4-hydroxy-2-methyl-1-piperidinecarboxylate
2-Methyl-2-propanyl (2R,4R)-4-hydroxy-2-methyl-1-piperidinecarboxylate structure
|
Common Name | 2-Methyl-2-propanyl (2R,4R)-4-hydroxy-2-methyl-1-piperidinecarboxylate | ||
|---|---|---|---|---|
| CAS Number | 790667-44-6 | Molecular Weight | 215.28900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H21NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 2-Methyl-2-propanyl (2R,4R)-4-hydroxy-2-methyl-1-piperidinecarboxylate (CAS: 790667-44-6, molecular formula: C11H21NO3, molecular weight: 215.28900) is a white to yellow solid. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Methyl-2-propanyl (2R,4R)-4-hydroxy-2-methyl-1-piperidinecarboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H21NO3 |
|---|---|
| Molecular Weight | 215.28900 |
| Exact Mass | 215.15200 |
| PSA | 49.77000 |
| LogP | 1.70460 |
| InChIKey | RCXJVQLRZJXWNM-RKDXNWHRSA-N |
| SMILES | CC1CC(O)CCN1C(=O)OC(C)(C)C |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi |
|---|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-hydroxy-2-methylpiperidine-1-carboxylic acid tert-butyl ester |
| (2R,4R)-tert-butyl 4-hydroxy-2-methylpiperidine-1-carboxylate |
| 1-Piperidinecarboxylicacid,4-hydroxy-2-methyl-,1,1-dimethylethylester,(2R,4R) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 2-Methyl-2-propanyl (2R,4R)-4-hydroxy-2-methyl-1-piperidinecarboxylate? |
| A: The English name of 2-Methyl-2-propanyl (2R,4R)-4-hydroxy-2-methyl-1-piperidinecarboxylate is 2-Methyl-2-propanyl (2R,4R)-4-hydroxy-2-methyl-1-piperidinecarboxylate. |
| Q: What is the LogP of 2-Methyl-2-propanyl (2R,4R)-4-hydroxy-2-methyl-1-piperidinecarboxylate? |
| A: LogP of 2-Methyl-2-propanyl (2R,4R)-4-hydroxy-2-methyl-1-piperidinecarboxylate is 1.70460. |
| Q: What is the polar surface area (PSA) of 2-Methyl-2-propanyl (2R,4R)-4-hydroxy-2-methyl-1-piperidinecarboxylate? |
| A: Polar surface area (PSA) of 2-Methyl-2-propanyl (2R,4R)-4-hydroxy-2-methyl-1-piperidinecarboxylate is 49.77000. |
| Q: What English synonyms does 2-Methyl-2-propanyl (2R,4R)-4-hydroxy-2-methyl-1-piperidinecarboxylate have? |
| A: English synonyms of 2-Methyl-2-propanyl (2R,4R)-4-hydroxy-2-methyl-1-piperidinecarboxylate: 4-hydroxy-2-methylpiperidine-1-carboxylic acid tert-butyl ester, (2R,4R)-tert-butyl 4-hydroxy-2-methylpiperidine-1-carboxylate, 1-Piperidinecarboxylicacid,4-hydroxy-2-methyl-,1,1-dimethylethylester,(2R,4R). |
| Q: What is the SMILES notation of 2-Methyl-2-propanyl (2R,4R)-4-hydroxy-2-methyl-1-piperidinecarboxylate? |
| A: SMILES notation of 2-Methyl-2-propanyl (2R,4R)-4-hydroxy-2-methyl-1-piperidinecarboxylate is CC1CC(O)CCN1C(=O)OC(C)(C)C. |
| Q: What is the molecular formula of 2-Methyl-2-propanyl (2R,4R)-4-hydroxy-2-methyl-1-piperidinecarboxylate? |
| A: Molecular formula of 2-Methyl-2-propanyl (2R,4R)-4-hydroxy-2-methyl-1-piperidinecarboxylate is C11H21NO3. |
| Q: What is the InChIKey of 2-Methyl-2-propanyl (2R,4R)-4-hydroxy-2-methyl-1-piperidinecarboxylate? |
| A: InChIKey of 2-Methyl-2-propanyl (2R,4R)-4-hydroxy-2-methyl-1-piperidinecarboxylate is RCXJVQLRZJXWNM-RKDXNWHRSA-N. |
| Q: What is the molecular weight of 2-Methyl-2-propanyl (2R,4R)-4-hydroxy-2-methyl-1-piperidinecarboxylate? |
| A: Molecular weight of 2-Methyl-2-propanyl (2R,4R)-4-hydroxy-2-methyl-1-piperidinecarboxylate is 215.28900. |
| Q: What is the CAS number of 2-Methyl-2-propanyl (2R,4R)-4-hydroxy-2-methyl-1-piperidinecarboxylate? |
| A: CAS number of 2-Methyl-2-propanyl (2R,4R)-4-hydroxy-2-methyl-1-piperidinecarboxylate is 790667-44-6. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |