4-Hydroxy-2-methylpiperidine-1-carboxylic acid tert-butyl ester
4-Hydroxy-2-methylpiperidine-1-carboxylic acid tert-butyl ester structure
|
Common Name | 4-Hydroxy-2-methylpiperidine-1-carboxylic acid tert-butyl ester | ||
|---|---|---|---|---|
| CAS Number | 790667-99-1 | Molecular Weight | 215.289 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 301.4±35.0 °C at 760 mmHg | |
| Molecular Formula | C11H21NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 136.1±25.9 °C | |
Summary: 4-hydroxy-2-methylpiperidine-1-carboxylic acid tert-butyl ester, Chinese name: (2S,4S)-4-羟基-2-甲基哌啶-1-羧酸叔丁酯, CAS number: 790667-99-1, molecular formula: C11H21NO3, molecular weight: 215.289. Appearance: white to yellow solid, boiling point: 301.4±35.0 °C at 760 mmHg, density: 1.1±0.1 g/cm3. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-hydroxy-2-methylpiperidine-1-carboxylic acid tert-butyl ester |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 301.4±35.0 °C at 760 mmHg |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.289 |
| Flash Point | 136.1±25.9 °C |
| Exact Mass | 215.152145 |
| PSA | 49.77000 |
| LogP | 1.10 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.484 |
| InChIKey | RCXJVQLRZJXWNM-IUCAKERBSA-N |
| SMILES | CC1CC(O)CCN1C(=O)OC(C)(C)C |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi |
|---|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-Methyl-2-propanyl (2S,4S)-4-hydroxy-2-methyl-1-piperidinecarboxylate |
| PBN20121086 |
| tert-butyl (2S,4S)-4-hydroxy-2-methylpiperidine-1-carboxylate |
| (2S,4S)-1-BOC-2-METHYL-4-HYDROXYPIPERIDINE |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 4-hydroxy-2-methylpiperidine-1-carboxylic acid tert-butyl ester? |
| A: InChIKey of 4-hydroxy-2-methylpiperidine-1-carboxylic acid tert-butyl ester is RCXJVQLRZJXWNM-IUCAKERBSA-N. |
| Q: What is the English name of 4-hydroxy-2-methylpiperidine-1-carboxylic acid tert-butyl ester? |
| A: The English name of 4-hydroxy-2-methylpiperidine-1-carboxylic acid tert-butyl ester is 4-hydroxy-2-methylpiperidine-1-carboxylic acid tert-butyl ester. |
| Q: What is the SMILES notation of 4-hydroxy-2-methylpiperidine-1-carboxylic acid tert-butyl ester? |
| A: SMILES notation of 4-hydroxy-2-methylpiperidine-1-carboxylic acid tert-butyl ester is CC1CC(O)CCN1C(=O)OC(C)(C)C. |
| Q: What is the CAS number of 4-hydroxy-2-methylpiperidine-1-carboxylic acid tert-butyl ester? |
| A: CAS number of 4-hydroxy-2-methylpiperidine-1-carboxylic acid tert-butyl ester is 790667-99-1. |
| Q: What is the molecular weight of 4-hydroxy-2-methylpiperidine-1-carboxylic acid tert-butyl ester? |
| A: Molecular weight of 4-hydroxy-2-methylpiperidine-1-carboxylic acid tert-butyl ester is 215.289. |
| Q: What is the boiling point of 4-hydroxy-2-methylpiperidine-1-carboxylic acid tert-butyl ester? |
| A: Boiling point of 4-hydroxy-2-methylpiperidine-1-carboxylic acid tert-butyl ester is 301.4±35.0 °C at 760 mmHg. |
| Q: What is the LogP of 4-hydroxy-2-methylpiperidine-1-carboxylic acid tert-butyl ester? |
| A: LogP of 4-hydroxy-2-methylpiperidine-1-carboxylic acid tert-butyl ester is 1.10. |
| Q: What English synonyms does 4-hydroxy-2-methylpiperidine-1-carboxylic acid tert-butyl ester have? |
| A: English synonyms of 4-hydroxy-2-methylpiperidine-1-carboxylic acid tert-butyl ester: 2-Methyl-2-propanyl (2S,4S)-4-hydroxy-2-methyl-1-piperidinecarboxylate, PBN20121086, tert-butyl (2S,4S)-4-hydroxy-2-methylpiperidine-1-carboxylate, (2S,4S)-1-BOC-2-METHYL-4-HYDROXYPIPERIDINE. |
| Q: What is the molecular formula of 4-hydroxy-2-methylpiperidine-1-carboxylic acid tert-butyl ester? |
| A: Molecular formula of 4-hydroxy-2-methylpiperidine-1-carboxylic acid tert-butyl ester is C11H21NO3. |
| Q: What is the polar surface area (PSA) of 4-hydroxy-2-methylpiperidine-1-carboxylic acid tert-butyl ester? |
| A: Polar surface area (PSA) of 4-hydroxy-2-methylpiperidine-1-carboxylic acid tert-butyl ester is 49.77000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |