4-(6-Formyl-pyridin-2-yl)benzonitrile
4-(6-Formyl-pyridin-2-yl)benzonitrile structure
|
Common Name | 4-(6-Formyl-pyridin-2-yl)benzonitrile | ||
|---|---|---|---|---|
| CAS Number | 834884-79-6 | Molecular Weight | 208.21500 | |
| Density | 1.25g/cm3 | Boiling Point | 398.1ºC at 760 mmHg | |
| Molecular Formula | C13H8N2O | Melting Point | 159-163ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 194.6ºC | |
| Symbol |
GHS06 |
Signal Word | Danger | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(6-formylpyridin-2-yl)benzonitrile |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 398.1ºC at 760 mmHg |
| Melting Point | 159-163ºC(lit.) |
| Molecular Formula | C13H8N2O |
| Molecular Weight | 208.21500 |
| Flash Point | 194.6ºC |
| Exact Mass | 208.06400 |
| PSA | 53.75000 |
| LogP | 2.43278 |
| Index of Refraction | 1.624 |
| InChIKey | PPAQGUBYGPCPLW-UHFFFAOYSA-N |
| SMILES | N#Cc1ccc(-c2cccc(C=O)n2)cc1 |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H315-H319-H335 |
| Precautionary Statements | P261-P301 + P310-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xn |
| Risk Phrases | 22-36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | UN 2811 6.1/PG 3 |
| HS Code | 2933399090 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~58%
4-(6-Formyl-pyr... CAS#:834884-79-6 |
| Literature: UNIVERSITY OF NORTH CAROLINA AT CHAPEL HILL; GEORGIA STATE UNIVERSITY RESEARCH FOUNDATION, INC. Patent: WO2005/33065 A1, 2005 ; Location in patent: Page/Page column 42 ; |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-(6-FORMYL-(PYRIDIN-2-YL))-BENZONITRILE |
| 4-(6-formyl-2-pyridinyl)benzonitrile |
| 6-(4-cyanophenyl)pyridine-2-carbaldehyde |
| BM512 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 4-(6-formylpyridin-2-yl)benzonitrile? |
| A: LogP of 4-(6-formylpyridin-2-yl)benzonitrile is 2.43278. |
| Q: What is the CAS number of 4-(6-formylpyridin-2-yl)benzonitrile? |
| A: CAS number of 4-(6-formylpyridin-2-yl)benzonitrile is 834884-79-6. |
| Q: What is the molecular weight of 4-(6-formylpyridin-2-yl)benzonitrile? |
| A: Molecular weight of 4-(6-formylpyridin-2-yl)benzonitrile is 208.21500. |
| Q: What is the melting point of 4-(6-formylpyridin-2-yl)benzonitrile? |
| A: Melting point of 4-(6-formylpyridin-2-yl)benzonitrile is 159-163ºC(lit.). |
| Q: What is the molecular formula of 4-(6-formylpyridin-2-yl)benzonitrile? |
| A: Molecular formula of 4-(6-formylpyridin-2-yl)benzonitrile is C13H8N2O. |
| Q: What is the boiling point of 4-(6-formylpyridin-2-yl)benzonitrile? |
| A: Boiling point of 4-(6-formylpyridin-2-yl)benzonitrile is 398.1ºC at 760 mmHg. |
| Q: What English synonyms does 4-(6-formylpyridin-2-yl)benzonitrile have? |
| A: English synonyms of 4-(6-formylpyridin-2-yl)benzonitrile: 4-(6-FORMYL-(PYRIDIN-2-YL))-BENZONITRILE, 4-(6-formyl-2-pyridinyl)benzonitrile, 6-(4-cyanophenyl)pyridine-2-carbaldehyde, BM512. |
| Q: What is the polar surface area (PSA) of 4-(6-formylpyridin-2-yl)benzonitrile? |
| A: Polar surface area (PSA) of 4-(6-formylpyridin-2-yl)benzonitrile is 53.75000. |
| Q: What are the upstream materials of 4-(6-formylpyridin-2-yl)benzonitrile? |
| A: Related upstream materials(CAS) of 4-(6-formylpyridin-2-yl)benzonitrile: 34160-40-2;126747-14-6. |
| Q: What is the SMILES notation of 4-(6-formylpyridin-2-yl)benzonitrile? |
| A: SMILES notation of 4-(6-formylpyridin-2-yl)benzonitrile is N#Cc1ccc(-c2cccc(C=O)n2)cc1. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |