2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)pyrene
2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)pyrene structure
|
Common Name | 2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)pyrene | ||
|---|---|---|---|---|
| CAS Number | 853377-11-4 | Molecular Weight | 328.21200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H21BO2 | Melting Point | 128 °C | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-(2-pyrenyl) |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Melting Point | 128 °C |
|---|---|
| Molecular Formula | C22H21BO2 |
| Molecular Weight | 328.21200 |
| Exact Mass | 328.16300 |
| PSA | 18.46000 |
| LogP | 4.88320 |
| InChIKey | PORWCBOPAQPLHP-UHFFFAOYSA-N |
| SMILES | CC1(C)OB(c2cc3ccc4cccc5ccc(c2)c3c45)OC1(C)C |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi |
|---|
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 3 | |
CAS#:185506-32-5
CAS#:146445-96-7
CAS#:78751-58-3This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| (2-Pyrenyl)boronic acid pinacol ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-(2-pyrenyl)? |
| A: Molecular formula of 1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-(2-pyrenyl) is C22H21BO2. |
| Q: What is the English name of 1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-(2-pyrenyl)? |
| A: The English name of 1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-(2-pyrenyl) is 1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-(2-pyrenyl). |
| Q: What is the InChIKey of 1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-(2-pyrenyl)? |
| A: InChIKey of 1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-(2-pyrenyl) is PORWCBOPAQPLHP-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-(2-pyrenyl)? |
| A: Polar surface area (PSA) of 1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-(2-pyrenyl) is 18.46000. |
| Q: What English synonyms does 1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-(2-pyrenyl) have? |
| A: English synonyms of 1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-(2-pyrenyl): (2-Pyrenyl)boronic acid pinacol ester. |
| Q: What are the downstream products of 1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-(2-pyrenyl)? |
| A: Related downstream products(CAS) of 1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-(2-pyrenyl): 185506-32-5;146445-96-7;78751-58-3. |
| Q: What is the SMILES notation of 1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-(2-pyrenyl)? |
| A: SMILES notation of 1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-(2-pyrenyl) is CC1(C)OB(c2cc3ccc4cccc5ccc(c2)c3c45)OC1(C)C. |
| Q: What is the CAS number of 1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-(2-pyrenyl)? |
| A: CAS number of 1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-(2-pyrenyl) is 853377-11-4. |
| Q: What is the melting point of 1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-(2-pyrenyl)? |
| A: Melting point of 1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-(2-pyrenyl) is 128 °C. |
| Q: What is the LogP of 1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-(2-pyrenyl)? |
| A: LogP of 1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-(2-pyrenyl) is 4.88320. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |