6-Fluoro-1H-indazol-3(2H)-one
6-Fluoro-1H-indazol-3(2H)-one structure
|
Common Name | 6-Fluoro-1H-indazol-3(2H)-one | ||
|---|---|---|---|---|
| CAS Number | 862274-39-3 | Molecular Weight | 152.126 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 369.2±22.0 °C at 760 mmHg | |
| Molecular Formula | C7H5FN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177.1±22.3 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-Fluoro-1H-indazol-3(2H)-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 369.2±22.0 °C at 760 mmHg |
| Molecular Formula | C7H5FN2O |
| Molecular Weight | 152.126 |
| Flash Point | 177.1±22.3 °C |
| Exact Mass | 152.038589 |
| PSA | 48.91000 |
| LogP | 1.80 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.717 |
| InChIKey | KBPHAHZMJXVUPU-UHFFFAOYSA-N |
| SMILES | O=c1[nH][nH]c2cc(F)ccc12 |
| Storage condition | 2-8°C |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~81%
6-Fluoro-1H-ind... CAS#:862274-39-3 |
| Literature: Aventis Pharma Deutschland GmbH Patent: US2005/197348 A1, 2005 ; Location in patent: Page/Page column 11 ; |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 6-Fluoro-1,2-dihydro-3H-indazol-3-one |
| 6-fluoro-1,2-dihydroindazol-3-one |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 6-Fluoro-1H-indazol-3(2H)-one? |
| A: SMILES notation of 6-Fluoro-1H-indazol-3(2H)-one is O=c1[nH][nH]c2cc(F)ccc12. |
| Q: What is the English name of 6-Fluoro-1H-indazol-3(2H)-one? |
| A: The English name of 6-Fluoro-1H-indazol-3(2H)-one is 6-Fluoro-1H-indazol-3(2H)-one. |
| Q: What is the molecular formula of 6-Fluoro-1H-indazol-3(2H)-one? |
| A: Molecular formula of 6-Fluoro-1H-indazol-3(2H)-one is C7H5FN2O. |
| Q: What is the CAS number of 6-Fluoro-1H-indazol-3(2H)-one? |
| A: CAS number of 6-Fluoro-1H-indazol-3(2H)-one is 862274-39-3. |
| Q: What is the molecular weight of 6-Fluoro-1H-indazol-3(2H)-one? |
| A: Molecular weight of 6-Fluoro-1H-indazol-3(2H)-one is 152.126. |
| Q: What is the InChIKey of 6-Fluoro-1H-indazol-3(2H)-one? |
| A: InChIKey of 6-Fluoro-1H-indazol-3(2H)-one is KBPHAHZMJXVUPU-UHFFFAOYSA-N. |
| Q: What is the boiling point of 6-Fluoro-1H-indazol-3(2H)-one? |
| A: Boiling point of 6-Fluoro-1H-indazol-3(2H)-one is 369.2±22.0 °C at 760 mmHg. |
| Q: What is the LogP of 6-Fluoro-1H-indazol-3(2H)-one? |
| A: LogP of 6-Fluoro-1H-indazol-3(2H)-one is 1.80. |
| Q: What are the upstream materials of 6-Fluoro-1H-indazol-3(2H)-one? |
| A: Related upstream materials(CAS) of 6-Fluoro-1H-indazol-3(2H)-one: 446-32-2. |
| Q: What is the polar surface area (PSA) of 6-Fluoro-1H-indazol-3(2H)-one? |
| A: Polar surface area (PSA) of 6-Fluoro-1H-indazol-3(2H)-one is 48.91000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |