fidaxomicin structure
|
Common Name | fidaxomicin | ||
|---|---|---|---|---|
| CAS Number | 873857-62-6 | Molecular Weight | 1058.039 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 1046.4±65.0 °C at 760 mmHg | |
| Molecular Formula | C52H74Cl2O18 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 586.7±34.3 °C | |
Use of fidaxomicinFidaxomicin(OPT-80; PAR-101) is a new class of narrow spectrum macrocyclic antibiotic drug; selective eradication of pathogenic Clostridium difficile with minimal disruption to the multiple species of bacteria that make up the normal, healthy intestinal flora. |
| Name | fidaxomicin |
|---|---|
| Synonym | More Synonyms |
| Description | Fidaxomicin(OPT-80; PAR-101) is a new class of narrow spectrum macrocyclic antibiotic drug; selective eradication of pathogenic Clostridium difficile with minimal disruption to the multiple species of bacteria that make up the normal, healthy intestinal flora. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 1046.4±65.0 °C at 760 mmHg |
| Molecular Formula | C52H74Cl2O18 |
| Molecular Weight | 1058.039 |
| Flash Point | 586.7±34.3 °C |
| Exact Mass | 1056.425171 |
| PSA | 266.66000 |
| LogP | 10.73 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.590 |
| InChIKey | ZVGNESXIJDCBKN-LFVYLQMWSA-N |
| SMILES | CCc1c(Cl)c(O)c(Cl)c(O)c1C(=O)OC1C(C)OC(OCC2=CC=CCC(O)C(C)=CC(CC)C(OC3OC(C)(C)C(OC(=O)C(C)C)C(O)C3O)C(C)=CC(C)=CCC(C(C)O)OC2=O)C(OC)C1O |
| lipiarmycin A3 |
| clostomicin B1 |
| (2R,3S,4S,5S,6R)-6-({(3E,5E,8S,9E,11S,12R,13E,15E,18S)-12-{[(2R,3S,4R,5S)-3,4-Dihydroxy-5-(isobutyryloxy)-6,6-dimethyltetrahydro-2H-pyran-2-yl]oxy}-11-ethyl-8-hydroxy-18-[(1R)-1-hydroxyethyl]-9,13,15-trimethyl-2-oxooxacyclooctadeca-3,5,9,13,15-pentaen-3-yl}methoxy)-4-hydroxy-5-methoxy-2-methyltetrahydro-2H-pyran-3-yl 3,5-dichloro-2-ethyl-4,6-dihydroxybenzoate (non-preferred name) |
| Dificid |
| Fidaxomicin |
| tiacumicin B |