tert-butyl 3-methyl-4-oxopyrrolidine-1-carboxylate
tert-butyl 3-methyl-4-oxopyrrolidine-1-carboxylate structure
|
Common Name | tert-butyl 3-methyl-4-oxopyrrolidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 885102-34-1 | Molecular Weight | 199.25 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | tert-Butyl 3-methyl-4-oxopyrrolidine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H17NO3 |
|---|---|
| Molecular Weight | 199.25 |
| InChIKey | JMDHMXMRWKYDGZ-UHFFFAOYSA-N |
| SMILES | CC1CN(C(=O)OC(C)(C)C)CC1=O |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xn |
|---|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| MFCD29918272 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of tert-Butyl 3-methyl-4-oxopyrrolidine-1-carboxylate? |
| A: Molecular weight of tert-Butyl 3-methyl-4-oxopyrrolidine-1-carboxylate is 199.25. |
| Q: What English synonyms does tert-Butyl 3-methyl-4-oxopyrrolidine-1-carboxylate have? |
| A: English synonyms of tert-Butyl 3-methyl-4-oxopyrrolidine-1-carboxylate: MFCD29918272. |
| Q: What is the SMILES notation of tert-Butyl 3-methyl-4-oxopyrrolidine-1-carboxylate? |
| A: SMILES notation of tert-Butyl 3-methyl-4-oxopyrrolidine-1-carboxylate is CC1CN(C(=O)OC(C)(C)C)CC1=O. |
| Q: What is the English name of tert-Butyl 3-methyl-4-oxopyrrolidine-1-carboxylate? |
| A: The English name of tert-Butyl 3-methyl-4-oxopyrrolidine-1-carboxylate is tert-Butyl 3-methyl-4-oxopyrrolidine-1-carboxylate. |
| Q: What is the molecular formula of tert-Butyl 3-methyl-4-oxopyrrolidine-1-carboxylate? |
| A: Molecular formula of tert-Butyl 3-methyl-4-oxopyrrolidine-1-carboxylate is C10H17NO3. |
| Q: What is the InChIKey of tert-Butyl 3-methyl-4-oxopyrrolidine-1-carboxylate? |
| A: InChIKey of tert-Butyl 3-methyl-4-oxopyrrolidine-1-carboxylate is JMDHMXMRWKYDGZ-UHFFFAOYSA-N. |
| Q: What is the CAS number of tert-Butyl 3-methyl-4-oxopyrrolidine-1-carboxylate? |
| A: CAS number of tert-Butyl 3-methyl-4-oxopyrrolidine-1-carboxylate is 885102-34-1. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |