7-(Trifluoromethyl)-1H-indazole
7-(Trifluoromethyl)-1H-indazole structure
|
Common Name | 7-(Trifluoromethyl)-1H-indazole | ||
|---|---|---|---|---|
| CAS Number | 885694-00-8 | Molecular Weight | 186.134 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 268.5±35.0 °C at 760 mmHg | |
| Molecular Formula | C8H5F3N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 116.2±25.9 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 7-(Trifluoromethyl)-1H-indazole |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 268.5±35.0 °C at 760 mmHg |
| Molecular Formula | C8H5F3N2 |
| Molecular Weight | 186.134 |
| Flash Point | 116.2±25.9 °C |
| Exact Mass | 186.040482 |
| PSA | 28.68000 |
| LogP | 2.39 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.560 |
| InChIKey | NCLVEPKBXAQQDN-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1cccc2cn[nH]c12 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
7-(Trifluoromet... CAS#:885694-00-8 |
| Literature: WO2006/50006 A2, ; Page/Page column 48 ; |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 1 | |
CAS#:885693-99-2This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 7-(Trifluoromethyl)-1H-indazole |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 7-(Trifluoromethyl)-1H-indazole? |
| A: Molecular formula of 7-(Trifluoromethyl)-1H-indazole is C8H5F3N2. |
| Q: What is the SMILES notation of 7-(Trifluoromethyl)-1H-indazole? |
| A: SMILES notation of 7-(Trifluoromethyl)-1H-indazole is FC(F)(F)c1cccc2cn[nH]c12. |
| Q: What is the molecular weight of 7-(Trifluoromethyl)-1H-indazole? |
| A: Molecular weight of 7-(Trifluoromethyl)-1H-indazole is 186.134. |
| Q: What is the boiling point of 7-(Trifluoromethyl)-1H-indazole? |
| A: Boiling point of 7-(Trifluoromethyl)-1H-indazole is 268.5±35.0 °C at 760 mmHg. |
| Q: What are the downstream products of 7-(Trifluoromethyl)-1H-indazole? |
| A: Related downstream products(CAS) of 7-(Trifluoromethyl)-1H-indazole: 885693-99-2. |
| Q: What is the CAS number of 7-(Trifluoromethyl)-1H-indazole? |
| A: CAS number of 7-(Trifluoromethyl)-1H-indazole is 885694-00-8. |
| Q: What is the LogP of 7-(Trifluoromethyl)-1H-indazole? |
| A: LogP of 7-(Trifluoromethyl)-1H-indazole is 2.39. |
| Q: What is the English name of 7-(Trifluoromethyl)-1H-indazole? |
| A: The English name of 7-(Trifluoromethyl)-1H-indazole is 7-(Trifluoromethyl)-1H-indazole. |
| Q: What is the polar surface area (PSA) of 7-(Trifluoromethyl)-1H-indazole? |
| A: Polar surface area (PSA) of 7-(Trifluoromethyl)-1H-indazole is 28.68000. |
| Q: What are the upstream materials of 7-(Trifluoromethyl)-1H-indazole? |
| A: Related upstream materials(CAS) of 7-(Trifluoromethyl)-1H-indazole: 112641-20-0. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |