ethyl 3-bromo-1H-pyrrolo[3,2-b]pyridine-2-carboxylate
![ethyl 3-bromo-1H-pyrrolo[3,2-b]pyridine-2-carboxylate Structure](https://image.chemsrc.com/caspic/022/889658-85-9.png)
ethyl 3-bromo-1H-pyrrolo[3,2-b]pyridine-2-carboxylate structure
|
Common Name | ethyl 3-bromo-1H-pyrrolo[3,2-b]pyridine-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 889658-85-9 | Molecular Weight | 269.09500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H9BrN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl 3-bromo-1H-pyrrolo[3,2-b]pyridine-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H9BrN2O2 |
|---|---|
| Molecular Weight | 269.09500 |
| Exact Mass | 267.98500 |
| PSA | 54.98000 |
| LogP | 2.50210 |
| InChIKey | IJSMPVSMWCDZKW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1[nH]c2cccnc2c1Br |
| Storage condition | 2-8°C |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
ethyl 3-bromo-1... CAS#:889658-85-9 |
| Literature: AVENTIS PHARMA S.A. Patent: US2007/259910 A1, 2007 ; Location in patent: Page/Page column 10 ; |
![Ethyl 1H-pyrrolo[3,2-b]pyridine-2-carboxylate structure](https://image.chemsrc.com/caspic/342/17288-32-3.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-BROMO-1H-PYRROLO[3,2-B]PYRIDINE-2-CARBOXYLIC ACID ETHYL ESTER |
| 3-bromo-1H-pyrrolo[3,2-b]pyridine-2-carboxylic nacid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of ethyl 3-bromo-1H-pyrrolo[3,2-b]pyridine-2-carboxylate? |
| A: CAS number of ethyl 3-bromo-1H-pyrrolo[3,2-b]pyridine-2-carboxylate is 889658-85-9. |
| Q: What English synonyms does ethyl 3-bromo-1H-pyrrolo[3,2-b]pyridine-2-carboxylate have? |
| A: English synonyms of ethyl 3-bromo-1H-pyrrolo[3,2-b]pyridine-2-carboxylate: 3-BROMO-1H-PYRROLO[3,2-B]PYRIDINE-2-CARBOXYLIC ACID ETHYL ESTER, 3-bromo-1H-pyrrolo[3,2-b]pyridine-2-carboxylic nacid. |
| Q: What is the SMILES notation of ethyl 3-bromo-1H-pyrrolo[3,2-b]pyridine-2-carboxylate? |
| A: SMILES notation of ethyl 3-bromo-1H-pyrrolo[3,2-b]pyridine-2-carboxylate is CCOC(=O)c1[nH]c2cccnc2c1Br. |
| Q: What is the molecular formula of ethyl 3-bromo-1H-pyrrolo[3,2-b]pyridine-2-carboxylate? |
| A: Molecular formula of ethyl 3-bromo-1H-pyrrolo[3,2-b]pyridine-2-carboxylate is C10H9BrN2O2. |
| Q: What are the upstream materials of ethyl 3-bromo-1H-pyrrolo[3,2-b]pyridine-2-carboxylate? |
| A: Related upstream materials(CAS) of ethyl 3-bromo-1H-pyrrolo[3,2-b]pyridine-2-carboxylate: 17288-32-3. |
| Q: What is the InChIKey of ethyl 3-bromo-1H-pyrrolo[3,2-b]pyridine-2-carboxylate? |
| A: InChIKey of ethyl 3-bromo-1H-pyrrolo[3,2-b]pyridine-2-carboxylate is IJSMPVSMWCDZKW-UHFFFAOYSA-N. |
| Q: What is the molecular weight of ethyl 3-bromo-1H-pyrrolo[3,2-b]pyridine-2-carboxylate? |
| A: Molecular weight of ethyl 3-bromo-1H-pyrrolo[3,2-b]pyridine-2-carboxylate is 269.09500. |
| Q: What is the English name of ethyl 3-bromo-1H-pyrrolo[3,2-b]pyridine-2-carboxylate? |
| A: The English name of ethyl 3-bromo-1H-pyrrolo[3,2-b]pyridine-2-carboxylate is ethyl 3-bromo-1H-pyrrolo[3,2-b]pyridine-2-carboxylate. |
| Q: What is the polar surface area (PSA) of ethyl 3-bromo-1H-pyrrolo[3,2-b]pyridine-2-carboxylate? |
| A: Polar surface area (PSA) of ethyl 3-bromo-1H-pyrrolo[3,2-b]pyridine-2-carboxylate is 54.98000. |
| Q: What is the LogP of ethyl 3-bromo-1H-pyrrolo[3,2-b]pyridine-2-carboxylate? |
| A: LogP of ethyl 3-bromo-1H-pyrrolo[3,2-b]pyridine-2-carboxylate is 2.50210. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |