2,3-Dichloro-6-(trifluoromethyl)pyridine
2,3-Dichloro-6-(trifluoromethyl)pyridine structure
|
Common Name | 2,3-Dichloro-6-(trifluoromethyl)pyridine | ||
|---|---|---|---|---|
| CAS Number | 89719-90-4 | Molecular Weight | 215.98800 | |
| Density | 1.542±0.06 g/cm3 | Boiling Point | 177.2±35.0 ℃ at 760 mmHg | |
| Molecular Formula | C6H2Cl2F3N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,3-Dichloro-6-(trifluoromethyl)pyridine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.542±0.06 g/cm3 |
|---|---|
| Boiling Point | 177.2±35.0 ℃ at 760 mmHg |
| Molecular Formula | C6H2Cl2F3N |
| Molecular Weight | 215.98800 |
| Exact Mass | 214.95200 |
| PSA | 12.89000 |
| LogP | 3.40720 |
| InChIKey | XFOQWQKDSMIPHT-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1ccc(Cl)c(Cl)n1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2,3-Dichloro-6-... CAS#:89719-90-4 |
| Literature: WO2009/117421 A2, ; Page/Page column 90 ; WO 2009/117421 A2 |
|
~%
2,3-Dichloro-6-... CAS#:89719-90-4 |
| Literature: US2013/261310 A1, ; Paragraph 0078; 0079 ; |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:349-94-0This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Pyridine,2,3-dichloro-6-(trifluoromethyl) |
| PC5363 |
| 2,3,5-TRIFLUOROTOLUENE |
| 2,3-dichloro-6-trifluoromethyl pyridine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 2,3-Dichloro-6-(trifluoromethyl)pyridine? |
| A: The English name of 2,3-Dichloro-6-(trifluoromethyl)pyridine is 2,3-Dichloro-6-(trifluoromethyl)pyridine. |
| Q: What are the downstream products of 2,3-Dichloro-6-(trifluoromethyl)pyridine? |
| A: Related downstream products(CAS) of 2,3-Dichloro-6-(trifluoromethyl)pyridine: 349-94-0. |
| Q: What are the upstream materials of 2,3-Dichloro-6-(trifluoromethyl)pyridine? |
| A: Related upstream materials(CAS) of 2,3-Dichloro-6-(trifluoromethyl)pyridine: 117519-09-2;51492-01-4. |
| Q: What is the SMILES notation of 2,3-Dichloro-6-(trifluoromethyl)pyridine? |
| A: SMILES notation of 2,3-Dichloro-6-(trifluoromethyl)pyridine is FC(F)(F)c1ccc(Cl)c(Cl)n1. |
| Q: What is the boiling point of 2,3-Dichloro-6-(trifluoromethyl)pyridine? |
| A: Boiling point of 2,3-Dichloro-6-(trifluoromethyl)pyridine is 177.2±35.0 ℃ at 760 mmHg. |
| Q: What is the molecular formula of 2,3-Dichloro-6-(trifluoromethyl)pyridine? |
| A: Molecular formula of 2,3-Dichloro-6-(trifluoromethyl)pyridine is C6H2Cl2F3N. |
| Q: What English synonyms does 2,3-Dichloro-6-(trifluoromethyl)pyridine have? |
| A: English synonyms of 2,3-Dichloro-6-(trifluoromethyl)pyridine: Pyridine,2,3-dichloro-6-(trifluoromethyl), PC5363, 2,3,5-TRIFLUOROTOLUENE, 2,3-dichloro-6-trifluoromethyl pyridine. |
| Q: What is the polar surface area (PSA) of 2,3-Dichloro-6-(trifluoromethyl)pyridine? |
| A: Polar surface area (PSA) of 2,3-Dichloro-6-(trifluoromethyl)pyridine is 12.89000. |
| Q: What is the InChIKey of 2,3-Dichloro-6-(trifluoromethyl)pyridine? |
| A: InChIKey of 2,3-Dichloro-6-(trifluoromethyl)pyridine is XFOQWQKDSMIPHT-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2,3-Dichloro-6-(trifluoromethyl)pyridine? |
| A: CAS number of 2,3-Dichloro-6-(trifluoromethyl)pyridine is 89719-90-4. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |