7-nitrobenzo[d]thiazol-2-amine structure
|
Common Name | 7-nitrobenzo[d]thiazol-2-amine | ||
|---|---|---|---|---|
| CAS Number | 89793-81-7 | Molecular Weight | 195.199 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 411.7±37.0 °C at 760 mmHg | |
| Molecular Formula | C7H5N3O2S | Melting Point | 126-129°C | |
| MSDS | N/A | Flash Point | 202.8±26.5 °C | |
| Name | 7-Nitrobenzo[d]thiazol-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 411.7±37.0 °C at 760 mmHg |
| Melting Point | 126-129°C |
| Molecular Formula | C7H5N3O2S |
| Molecular Weight | 195.199 |
| Flash Point | 202.8±26.5 °C |
| Exact Mass | 195.010239 |
| PSA | 112.97000 |
| LogP | 1.62 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.798 |
| InChIKey | JMRCAIHFSHXPPH-UHFFFAOYSA-N |
| SMILES | Nc1nc2cccc([N+](=O)[O-])c2s1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2934200090 |
|
~67%
7-nitrobenzo[d]... CAS#:89793-81-7 |
| Literature: YUHAN CORPORATION; HUR, Youn; KIM, Dong-Hyun; KIM, Eun-Kyung; PARK, Jin-Hwi; JOO, Jae-Eun; KANG, Ho-Woong; OH, Se-Woong; KIM, Dong-Kyun; AHN, Kyoung-Kyu Patent: WO2013/43001 A1, 2013 ; Location in patent: Paragraph 243; 244; 245 ; |
|
~%
7-nitrobenzo[d]... CAS#:89793-81-7 |
| Literature: WO2013/43001 A1, ; |
|
~%
7-nitrobenzo[d]... CAS#:89793-81-7 |
| Literature: Ukrainskii Khimicheskii Zhurnal (Russian Edition), , vol. 22, p. 363,365 Chem.Abstr., , p. 4358 |
| HS Code | 2934200090 |
|---|---|
| Summary | 2934200090. other compounds containing in the structure a benzothiazole ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 7-Nitro-1,3-benzothiazol-2-amine |