4-Cyclohexyl-3-(trifluoromethyl)benzoic acid
4-Cyclohexyl-3-(trifluoromethyl)benzoic acid structure
|
Common Name | 4-Cyclohexyl-3-(trifluoromethyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 916806-97-8 | Molecular Weight | 272.263 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 349.8±42.0 °C at 760 mmHg | |
| Molecular Formula | C14H15F3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165.3±27.9 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Cyclohexyl-3-(trifluoromethyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 349.8±42.0 °C at 760 mmHg |
| Molecular Formula | C14H15F3O2 |
| Molecular Weight | 272.263 |
| Flash Point | 165.3±27.9 °C |
| Exact Mass | 272.102417 |
| LogP | 5.47 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.503 |
| InChIKey | XIWQGDFYIINJLV-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(C2CCCCC2)c(C(F)(F)F)c1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi |
|---|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| MFCD29072797 |
| 4-Cyclohexyl-3-(trifluoromethyl)benzoic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 4-Cyclohexyl-3-(trifluoromethyl)benzoic acid? |
| A: Molecular weight of 4-Cyclohexyl-3-(trifluoromethyl)benzoic acid is 272.263. |
| Q: What is the boiling point of 4-Cyclohexyl-3-(trifluoromethyl)benzoic acid? |
| A: Boiling point of 4-Cyclohexyl-3-(trifluoromethyl)benzoic acid is 349.8±42.0 °C at 760 mmHg. |
| Q: What is the InChIKey of 4-Cyclohexyl-3-(trifluoromethyl)benzoic acid? |
| A: InChIKey of 4-Cyclohexyl-3-(trifluoromethyl)benzoic acid is XIWQGDFYIINJLV-UHFFFAOYSA-N. |
| Q: What English synonyms does 4-Cyclohexyl-3-(trifluoromethyl)benzoic acid have? |
| A: English synonyms of 4-Cyclohexyl-3-(trifluoromethyl)benzoic acid: MFCD29072797, 4-Cyclohexyl-3-(trifluoromethyl)benzoic acid. |
| Q: What is the SMILES notation of 4-Cyclohexyl-3-(trifluoromethyl)benzoic acid? |
| A: SMILES notation of 4-Cyclohexyl-3-(trifluoromethyl)benzoic acid is O=C(O)c1ccc(C2CCCCC2)c(C(F)(F)F)c1. |
| Q: What is the molecular formula of 4-Cyclohexyl-3-(trifluoromethyl)benzoic acid? |
| A: Molecular formula of 4-Cyclohexyl-3-(trifluoromethyl)benzoic acid is C14H15F3O2. |
| Q: What is the LogP of 4-Cyclohexyl-3-(trifluoromethyl)benzoic acid? |
| A: LogP of 4-Cyclohexyl-3-(trifluoromethyl)benzoic acid is 5.47. |
| Q: What is the English name of 4-Cyclohexyl-3-(trifluoromethyl)benzoic acid? |
| A: The English name of 4-Cyclohexyl-3-(trifluoromethyl)benzoic acid is 4-Cyclohexyl-3-(trifluoromethyl)benzoic acid. |
| Q: What is the CAS number of 4-Cyclohexyl-3-(trifluoromethyl)benzoic acid? |
| A: CAS number of 4-Cyclohexyl-3-(trifluoromethyl)benzoic acid is 916806-97-8. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |