CALCIUM PYROPHOSPHATE structure
|
Common Name | CALCIUM PYROPHOSPHATE | ||
|---|---|---|---|---|
| CAS Number | 7790-76-3 | Molecular Weight | 254.09900 | |
| Density | 3.09 g/mL at 25 °C(lit.) | Boiling Point | N/A | |
| Molecular Formula | Ca2O7P2 | Melting Point | 1230 °C | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | Calcium Pyrophosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 3.09 g/mL at 25 °C(lit.) |
|---|---|
| Melting Point | 1230 °C |
| Molecular Formula | Ca2O7P2 |
| Molecular Weight | 254.09900 |
| Exact Mass | 253.83700 |
| PSA | 155.23000 |
| LogP | 0.94120 |
| InChIKey | JUNWLZAGQLJVLR-UHFFFAOYSA-J |
| SMILES | O=P([O-])([O-])OP(=O)([O-])[O-].[Ca+2].[Ca+2] |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
Strontium-impregnated bioabsorbable composite for osteoporotic fracture fixation.
J. Biomed. Mater. Res. A 103 , 3355-63, (2015) Osteoporosis impairs the bone-healing process as well as bone fracture fixation. The intervention of osteoporosis is considered to be one part of bone fracture treatment. Thus, orthopedic fixators imp... |
|
|
Acute crystalline arthritis in an artificial knee.
J. Clin. Rheumatol. 18(4) , 203-4, (2012)
|
|
|
Pathology quiz case 2. Tophaceous pseudogout (calcium pyrophosphate deposition disease [CPDD]) of the TMJ.
Arch. Otolaryngol. Head Neck Surg. 138(9) , 873-5, (2012)
|
| dicalcium,phosphonato phosphate |
| EINECS 232-221-5 |
| MFCD00015983 |