Santalol structure
|
Common Name | Santalol | ||
|---|---|---|---|---|
| CAS Number | 11031-45-1 | Molecular Weight | 220.350 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 312.0±11.0 °C at 760 mmHg | |
| Molecular Formula | C15H24O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 116.3±15.6 °C | |
Use of SantalolSantalol is a mixture of α and β-isomer santalol. α-santalol is isolated from sandalwood oil. α-santalol is a promising anti-cancer agent against cancers such as oral, breast, prostate and skin cancer[1]. |
| Name | 2-Methyl-5-((1S,2S,4R)-2-methyl-3-methylenebicyclo[2.2.1]heptan-2-yl)pent-2-en-1-ol |
|---|---|
| Synonym | More Synonyms |
| Description | Santalol is a mixture of α and β-isomer santalol. α-santalol is isolated from sandalwood oil. α-santalol is a promising anti-cancer agent against cancers such as oral, breast, prostate and skin cancer[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 312.0±11.0 °C at 760 mmHg |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.350 |
| Flash Point | 116.3±15.6 °C |
| Exact Mass | 220.182709 |
| PSA | 20.23000 |
| LogP | 4.87 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.515 |
| InChIKey | OJYKYCDSGQGTRJ-VZUCSPMQSA-N |
| SMILES | C=C1C2CCC(C2)C1(C)CCC=C(C)CO |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|
| L535 B 1A GTJ D3UY1&1Q D1 E1 |
| Santalol |
| 2-Methyl-5-(6-methyl-5-methylidene-6-bicyclo[2.2.1]heptanyl)pent-2-en-1-ol |
| 2-Methyl-5-(2-methyl-3-methylenebicyclo[2.2.1]hept-2-yl)-2-penten-1-ol |
| EINECS 234-262-4 |