3-Isocyanatopropyltriethoxysilane structure
|
Common Name | 3-Isocyanatopropyltriethoxysilane | ||
|---|---|---|---|---|
| CAS Number | 24801-88-5 | Molecular Weight | 247.363 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 263.0±13.0 °C at 760 mmHg | |
| Molecular Formula | C10H21NO4Si | Melting Point | <0ºC | |
| MSDS | Chinese USA | Flash Point | 112.9±19.8 °C | |
| Symbol |
GHS05, GHS06, GHS08 |
Signal Word | Danger | |
| Name | 3-Isocyanatopropyltriethoxysilane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 263.0±13.0 °C at 760 mmHg |
| Melting Point | <0ºC |
| Molecular Formula | C10H21NO4Si |
| Molecular Weight | 247.363 |
| Flash Point | 112.9±19.8 °C |
| Exact Mass | 247.123978 |
| PSA | 57.12000 |
| LogP | 2.87 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.432 |
| InChIKey | FRGPKMWIYVTFIQ-UHFFFAOYSA-N |
| SMILES | CCO[Si](CCCN=C=O)(OCC)OCC |
| Storage condition | 2-8°C |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS05, GHS06, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302 + H312-H314-H330-H334 |
| Precautionary Statements | P260-P280-P284-P303 + P361 + P353-P304 + P340 + P310-P305 + P351 + P338 |
| Personal Protective Equipment | Faceshields;full-face respirator (US);Gloves;Goggles;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | T+:Verytoxic; |
| Risk Phrases | R21/22;R26;R34;R42 |
| Safety Phrases | S23-S26-S28-S36/37/39-S45 |
| RIDADR | UN 3390 6.1/PG 1 |
| WGK Germany | 3 |
| RTECS | VV6691000 |
| Packaging Group | III |
| Hazard Class | 6.1 |
| HS Code | 2931900090 |
| Precursor 1 | |
|---|---|
| DownStream 10 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
|
Activatable two-photon fluorescence nanoprobe for bioimaging of glutathione in living cells and tissues.
Anal. Chem. 86(24) , 12321-6, (2014) Glutathione (GSH) serves vital cellular biological functions, and its abnormal levels are associated with many diseases. To better understand its physiological and pathological functions, efficient me... |
|
|
High efficiency, narrow particle size distribution, sub-2 μm based macrocyclic glycopeptide chiral stationary phases in HPLC and SFC.
Anal. Chim. Acta 898 , 128-37, (2015) State of the art chiral chromatography still employs 3-5 μm bonded or immobilized chiral selectors in 10-25 cm columns. With the availability of 1.9 μm narrow particle size distribution (NPSD) silica,... |
|
|
Single-step approach for fabrication of vancomycin-bonded silica monolith as chiral stationary phase.
J. Chromatogr. A. 1358 , 208-16, (2014) A vancomycin-bonded silica monolithic column for capillary electrochromatography (CEC) was prepared by a single-step in situ sol-gel approach. This sol-gel process incorporates a synthetic sol-gel pre... |
| 3-triethoxysilylpropyl isocyanate |
| 3-(triethoxysilyl)-propylisocyanate |
| 3-Isocyanatopropyltriethoxysil |
| Isocyanic Acid 3-(Triethoxysilyl)propyl Ester |
| i7840 |
| 3-(triethoxysilyl)-propyl-isocyanate |
| (3-Isocyanatopropyl)triethoxysilane |
| yh9030 |
| MFCD00051459 |
| y9030 |
| 3-isocyanatepropyltriethoxysilane |
| 1-triethoxysilyl-3-isocyanatopropane |
| EINECS 246-467-6 |
| Triethoxy(3-isocyanatopropyl)silane |
| 3-triethoxysilanylpropyl isocyanate |
| 3-(triethoxysilyl)-propyl isocyanate |
| 3-Isocyanatopropyltriethoxysilane |
| 3-(Triethoxysilyl)propyl Isocyanate |
| 3-(triethoxysilyl)propylisocyanate |
| Isocyanatopropyltriethoxysilane |