1-Testosterone structure
|
Common Name | 1-Testosterone | ||
|---|---|---|---|---|
| CAS Number | 65-06-5 | Molecular Weight | 288.424 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 420.5±45.0 °C at 760 mmHg | |
| Molecular Formula | C19H28O2 | Melting Point | 75-85°C | |
| MSDS | N/A | Flash Point | 179.5±21.3 °C | |
| Name | 1-Testosterone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 420.5±45.0 °C at 760 mmHg |
| Melting Point | 75-85°C |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.424 |
| Flash Point | 179.5±21.3 °C |
| Exact Mass | 288.208923 |
| PSA | 37.30000 |
| LogP | 3.44 |
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |
| Index of Refraction | 1.550 |
| InChIKey | OKJCFMUGMSVJBG-ABEVXSGRSA-N |
| SMILES | CC12C=CC(=O)CC1CCC1C2CCC2(C)C(O)CCC12 |
| Storage condition | Controlled Substance, -20?C Freezer |
| Hazard Codes | Xi |
|---|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| (5S,8R,9S,10R,13S,14S,17S)-17-hydroxy-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| MFCD00171609 |
| (5α,17β)-17-Hydroxyandrost-1-en-3-one |
| 5Alpha-Androst-1-En-3-One-17-Ol |
| 17β-Hydroxy-5α-androst-1-en-3-one |
| 17b-Hydroxy-5a-androst-1-en-3-one |
| 17beta-hydroxy-5alpha-androst-1-en-3-one |
| Androstendolone |
| 1-DEHYDROANDROSTANOLONE |