Cyclosporin H structure
|
Common Name | Cyclosporin H | ||
|---|---|---|---|---|
| CAS Number | 83602-39-5 | Molecular Weight | 1216.638 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 1282.0±65.0 °C at 760 mmHg | |
| Molecular Formula | C62H111N11O12 | Melting Point | 162-165ºC | |
| MSDS | N/A | Flash Point | 729.1±34.3 °C | |
Use of Cyclosporin HCyclosporin H, a viral transduction enhancer, increases lentiviral transduction up to 10-fold in human cord blood-derived hematopoietic stem and progenitor cells (HSPCs). Cyclosporin H displays an additive effect when combined with Rapamycin or prostaglandin E2. Cyclosporin H lacks immunosuppressant activity of cyclosporin A. |
| Name | Cyclosporin H |
|---|---|
| Synonym | More Synonyms |
| Description | Cyclosporin H, a viral transduction enhancer, increases lentiviral transduction up to 10-fold in human cord blood-derived hematopoietic stem and progenitor cells (HSPCs). Cyclosporin H displays an additive effect when combined with Rapamycin or prostaglandin E2. Cyclosporin H lacks immunosuppressant activity of cyclosporin A. |
|---|---|
| Related Catalog |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 1282.0±65.0 °C at 760 mmHg |
| Melting Point | 162-165ºC |
| Molecular Formula | C62H111N11O12 |
| Molecular Weight | 1216.638 |
| Flash Point | 729.1±34.3 °C |
| Exact Mass | 1215.857056 |
| PSA | 270.01000 |
| LogP | 4.28 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.469 |
| InChIKey | PMATZTZNYRCHOR-JLPRAAIDSA-N |
| SMILES | CC=CCC(C)C(O)C1C(=O)NC(CC)C(=O)N(C)CC(=O)N(C)C(CC(C)C)C(=O)NC(C(C)C)C(=O)N(C)C(CC(C)C)C(=O)NC(C)C(=O)NC(C)C(=O)N(C)C(CC(C)C)C(=O)N(C)C(CC(C)C)C(=O)N(C)C(C(C)C)C(=O)N1C |
| (3S,6S,9S,12R,15S,18S,21R,24S,30S)-30-Ethyl-33-[(1R,2R,4E)-1-hydroxy-2-methyl-4-hexen-1-yl]-6,9,18,24-tetraisobutyl-3,21-diisopropyl-1,4,7,10,12,15,19,22,25,28-decamethyl-1,4,7,10,13,16,19,22,25,28,31-undecaazacyclotritriacontane-2,5,8,11,14,17,20,23,26,29,32-undecone |
| CyclosporinH |
| cyclosiversioside H |
| Cyclosporin Impurity 8 |