(3S)-N-Boc-2-azabicyclo[2.2.1]heptane-3-carboxylic acid structure
|
Common Name | (3S)-N-Boc-2-azabicyclo[2.2.1]heptane-3-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 291775-59-2 | Molecular Weight | 241.284 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 371.0±25.0 °C at 760 mmHg | |
| Molecular Formula | C12H19NO4 | Melting Point | 147-152ºC | |
| MSDS | Chinese USA | Flash Point | 178.2±23.2 °C | |
| Symbol |
GHS07, GHS08, GHS09 |
Signal Word | Danger | |
| Name | (1R,3S,4S)-N-Boc-2-azabicyclo[2.2.1]heptane-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 371.0±25.0 °C at 760 mmHg |
| Melting Point | 147-152ºC |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.284 |
| Flash Point | 178.2±23.2 °C |
| Exact Mass | 241.131409 |
| PSA | 66.84000 |
| LogP | 0.98 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.527 |
| InChIKey | IFAMSTPTNRJBRG-YIZRAAEISA-N |
| SMILES | CC(C)(C)OC(=O)N1C2CCC(C2)C1C(=O)O |
| Symbol |
GHS07, GHS08, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H315-H319-H335-H360-H400 |
| Precautionary Statements | P201-P261-P273-P305 + P351 + P338-P308 + P313 |
| Personal Protective Equipment | Eyeshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | Xi: Irritant;N: Dangerous for the environment; |
| Risk Phrases | 61-36/37/38 |
| Safety Phrases | 53-26-61 |
| RIDADR | UN 3077 9/PG 3 |
|
Novel inhibitors of hepatitis C NS3-NS4A serine protease derived from 2-aza-bicyclo[2.2.1]heptane-3-carboxylic acid.
Bioorg. Med. Chem. Lett. 16 , 1628, (2006) Prolonged hepatitis C infection is the leading cause for cirrhosis of the liver and hepatocellular carcinoma. The etiological agent HCV virus codes a single polyprotein of approximately 3000 amino aci... |
|
|
Tetrahedron Lett. 36 , 6765, (1995)
|
| (1R,3S,4S)-2-{[(2-Methyl-2-propanyl)oxy]carbonyl}-2-azabicyclo[2.2.1]heptane-3-carboxylic acid |
| (1R,3S,4S)-N-Boc-2-azabicyclo[2.2.1]heptane-3-carboxylic acid |
| T55 A CNTJ CVOX1&1&1 DVQ &&(1R,3S,4S)- Form |