tert-butyl 4-(4-bromo-1H-pyrazol-1-yl)piperidine-1-carboxylate structure
|
Common Name | tert-butyl 4-(4-bromo-1H-pyrazol-1-yl)piperidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 877399-50-3 | Molecular Weight | 330.221 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 411.5±35.0 °C at 760 mmHg | |
| Molecular Formula | C13H20BrN3O2 | Melting Point | 79 °C | |
| MSDS | USA | Flash Point | 202.7±25.9 °C | |
| Name | 4-(4-Bromopyrazol-1-yl)Piperidine-1-Carboxylic Acid Tert-Butyl Ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 411.5±35.0 °C at 760 mmHg |
| Melting Point | 79 °C |
| Molecular Formula | C13H20BrN3O2 |
| Molecular Weight | 330.221 |
| Flash Point | 202.7±25.9 °C |
| Exact Mass | 329.073883 |
| PSA | 47.36000 |
| LogP | 2.62 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.594 |
| InChIKey | IYNZAVDBHAQODX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(n2cc(Br)cn2)CC1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
|
~72%
tert-butyl 4-(4... CAS#:877399-50-3 |
| Literature: Journal of Medicinal Chemistry, , vol. 54, # 12 p. 4092 - 4108 |
|
~%
tert-butyl 4-(4... CAS#:877399-50-3 |
| Literature: WO2013/53983 A1, ; |
|
~%
tert-butyl 4-(4... CAS#:877399-50-3 |
| Literature: WO2013/53983 A1, ; |
|
~%
tert-butyl 4-(4... CAS#:877399-50-3 |
| Literature: WO2013/53983 A1, ; |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| tert-butyl 4-(4-bromopyrazol-1-yl)piperidine-1-carboxylate |
| tert-Butyl 4-(4-bromo-1H-pyrazol-1-yl)piperidine-1-carboxylate |
| 1-Piperidinecarboxylic acid, 4-(4-bromo-1H-pyrazol-1-yl)-, 1,1-dimethylethyl ester |
| 2-Methyl-2-propanyl 4-(4-bromo-1H-pyrazol-1-yl)-1-piperidinecarboxylate |