Fmoc-L-Lys(Boc,iPr)-OH structure
|
Common Name | Fmoc-L-Lys(Boc,iPr)-OH | ||
|---|---|---|---|---|
| CAS Number | 201003-48-7 | Molecular Weight | 510.622 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 677.1±55.0 °C at 760 mmHg | |
| Molecular Formula | C29H38N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 363.3±31.5 °C | |
Use of Fmoc-L-Lys(Boc,iPr)-OHFmoc-Lys(ipr,Boc)-OH is a lysine derivative[1]. |
| Name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(2-methylpropan-2-yl)oxycarbonyl-propan-2-ylamino]hexanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Fmoc-Lys(ipr,Boc)-OH is a lysine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 677.1±55.0 °C at 760 mmHg |
| Molecular Formula | C29H38N2O6 |
| Molecular Weight | 510.622 |
| Flash Point | 363.3±31.5 °C |
| Exact Mass | 510.272980 |
| PSA | 105.17000 |
| LogP | 6.33 |
| Appearance of Characters | Solid |
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |
| Index of Refraction | 1.558 |
| InChIKey | LUGFCMICCJNLBC-VWLOTQADSA-N |
| SMILES | CC(C)N(CCCCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O)C(=O)OC(C)(C)C |
| Storage condition | -15°C |
| AmbotzFAA1447 |
| N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-N-isopropyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-lysine |
| N-Fmoc-N'-Boc-N'-isopropyl-L-lysine |
| Fmoc-Lys(Boc)(isopropyl)-OH |
| Fmoc-Lys(ipr,Boc)-OH |