Boc-Met(O2)-OH structure
|
Common Name | Boc-Met(O2)-OH | ||
|---|---|---|---|---|
| CAS Number | 60280-45-7 | Molecular Weight | 281.326 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 523.4±45.0 °C at 760 mmHg | |
| Molecular Formula | C10H19NO6S | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 270.3±28.7 °C | |
| Name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfonylbutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 523.4±45.0 °C at 760 mmHg |
| Molecular Formula | C10H19NO6S |
| Molecular Weight | 281.326 |
| Flash Point | 270.3±28.7 °C |
| Exact Mass | 281.093292 |
| PSA | 118.15000 |
| LogP | 0.51 |
| Vapour Pressure | 0.0±3.0 mmHg at 25°C |
| Index of Refraction | 1.491 |
| InChIKey | CPGDRHNBSOQFMF-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CCS(C)(=O)=O)C(=O)O |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2924199090 |
|
~81%
Boc-Met(O2)-OH CAS#:60280-45-7 |
| Literature: Van Nispen; Bijl; Hendrix; Greven Recueil des Travaux Chimiques des Pays Bas, 1983 , vol. 102, # 5 p. 276 - 283 |
|
~%
Boc-Met(O2)-OH CAS#:60280-45-7 |
| Literature: Journal of Natural Products, , vol. 76, # 4 p. 755 - 758 |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| AmbotzBAA1309 |
| N-Boc-L-methionine sulfone |
| (2S)-2-[(tert-butoxycarbonyl)amino]-4-(methylsulfonyl)butanoic acid |
| MFCD00065587 |
| (S)-2-tert-butoxycarbonylamino-4-methanesulfonylbutyric acid |
| N-Boc-methionine-sulfone |
| Boc-L-Met(O2)-Oh |
| N-Boc-(S)-methionine sulfone |
| Boc-L-methionine sulfone |
| (2S)-2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-4-(methylsulfonyl)butanoic acid |
| Boc-Met(O2)-OH |
| (S)-2-[(TERT-BUTOXYCARBONYL)AMINO]-4-METHYLSULFONYLBUTANOIC ACID |